|
|
| (2 intermediate revisions by the same user not shown) |
| Line 1: |
Line 1: |
| − | [[Category:Metabolite]] | + | [[Category:Reaction]] |
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NADPH NADPH] == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UROGENIIISYN-RXN UROGENIIISYN-RXN] == |
| − | * smiles:
| + | * direction: |
| − | ** C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))C=C(CC=5)C(=O)N)
| + | ** LEFT-TO-RIGHT |
| − | * inchi key: | + | |
| − | ** InChIKey=ACFIXJIJDZMPPO-NNYOXOHSSA-J | + | |
| | * common name: | | * common name: |
| − | ** NADPH | + | ** uroporphyrinogen synthase, putative chloroplast precursor |
| − | * molecular weight: | + | * ec number: |
| − | ** 741.394 | + | ** [http://enzyme.expasy.org/EC/4.2.1.75 EC-4.2.1.75] |
| | * Synonym(s): | | * Synonym(s): |
| − | ** reduced nicotinamide adenine dinucleotide phosphate
| |
| − | ** NADPH2
| |
| − | ** dihydrotriphosphopyridine nucleotide
| |
| − | ** reduced dihydrotriphosphopyridine nucleotide
| |
| − | ** dihydronicotinamide adenine dinucleotide phosphate
| |
| − | ** dihydronicotinamide adenine dinucleotide phosphate reduced
| |
| − | ** reduced NADP
| |
| − | ** NADP-red
| |
| − | ** TPNH
| |
| − | ** dihydronicotinamide adenine dinucleotide-P
| |
| − | ** β-NADPH
| |
| | | | |
| − | == Reaction(s) known to consume the compound == | + | == Reaction Formula == |
| − | * [[RXN-7660]] | + | * With identifiers: |
| − | * [[RXN1G-1053]] | + | ** 1 [[HYDROXYMETHYLBILANE]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[UROPORPHYRINOGEN-III]][c] |
| − | * [[RXN-4144]] | + | * With common name(s): |
| − | * [[RXN-7665]]
| + | ** 1 preuroporphyrinogen[c] '''=>''' 1 H2O[c] '''+''' 1 uroporphyrinogen-III[c] |
| − | * [[RXN-16616]]
| + | |
| − | * [[RXN66-323]]
| + | == Genes associated with this reaction == |
| − | * [[RXN-711]]
| + | Genes have been associated with this reaction based on different elements listed below. |
| − | * [[RXN-16129]]
| + | * Gene: [[Ec-12_004890]] |
| − | * [[RXN-715]]
| + | ** Source: [[annotation-esiliculosus_genome]] |
| − | * [[RXN1G-349]]
| + | *** Assignment: EC-NUMBER |
| − | * [[RXN-7664]]
| + | == Pathways == |
| − | * [[RXN-600]]
| + | * [[PWY-5189]], tetrapyrrole biosynthesis II (from glycine): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5189 PWY-5189] |
| − | * [[1.14.13.70-RXN]]
| + | ** '''3''' reactions found over '''4''' reactions in the full pathway |
| − | * [[RXN-7666]]
| + | * [[PWY-5188]], tetrapyrrole biosynthesis I (from glutamate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5188 PWY-5188] |
| − | * [[THIOREDOXIN-REDUCT-NADPH-RXN]]
| + | ** '''6''' reactions found over '''6''' reactions in the full pathway |
| − | * [[RXN-13307]]
| + | == Reconstruction information == |
| − | * [[RXN-17678]]
| + | * Category: [[annotation]] |
| − | * [[RXN-4225]]
| + | ** Source: [[annotation-esiliculosus_genome]] |
| − | * [[RXN-9546]]
| + | *** Tool: [[pathwaytools]] |
| − | * [[RXN66-12]]
| + | |
| − | * [[RXN-17109]]
| + | |
| − | * [[RXN-7677]]
| + | |
| − | * [[RXN-7676]]
| + | |
| − | * [[UDPNACETYLMURAMATEDEHYDROG-RXN]]
| + | |
| − | * [[1.2.1.13-RXN]]
| + | |
| − | * [[RXN-7784]]
| + | |
| − | * [[RXN0-2142]]
| + | |
| − | * [[RXN-13398]]
| + | |
| − | * [[RXN1G-358]]
| + | |
| − | * [[RXN-16114]]
| + | |
| − | * [[RXN-16112]]
| + | |
| − | * [[RXN-3142]]
| + | |
| − | * [[RXN-15046]]
| + | |
| − | * [[RXN-10625]]
| + | |
| − | * [[GLUTSEMIALDEHYDROG-RXN]]
| + | |
| − | * [[RXN1G-260]]
| + | |
| − | * [[RXN1G-508]]
| + | |
| − | * [[RXN-17428]]
| + | |
| − | * [[RXN-13707]]
| + | |
| − | * [[RXN-9536]]
| + | |
| − | * [[RXN-9532]]
| + | |
| − | * [[RXN-14014]]
| + | |
| − | * [[RXN-11881]]
| + | |
| − | * [[RXN-17111]]
| + | |
| − | * [[RXN-1106]]
| + | |
| − | * [[RXN1G-364]]
| + | |
| − | * [[RXN-1102]]
| + | |
| − | * [[RXN-1101]]
| + | |
| − | * [[RXN1G-287]]
| + | |
| − | * [[RXN-5285]]
| + | |
| − | * [[RXN-9633]]
| + | |
| − | * [[RXN-9524]]
| + | |
| − | * [[RXN-9528]]
| + | |
| − | * [[RXN1A0-6303]]
| + | |
| − | * [[RXN0-1281]]
| + | |
| − | * [[RXN-16765]]
| + | |
| − | * [[RXN-14790]]
| + | |
| − | * [[NADPH-DEHYDROGENASE-FLAVIN-RXN]]
| + | |
| − | * [[GLUTRNAREDUCT-RXN]]
| + | |
| − | * [[RXN-14715]]
| + | |
| − | * [[RXN-9540]]
| + | |
| − | * [[RXN-9556]]
| + | |
| − | * [[RXN-13724]]
| + | |
| − | * [[RXN-9552]]
| + | |
| − | * [[RXN-707]]
| + | |
| − | * [[RXN-13431]]
| + | |
| − | * [[KYNURENINE-3-MONOOXYGENASE-RXN]]
| + | |
| − | * [[RXN-4210]]
| + | |
| − | * [[RXN1G-881]]
| + | |
| − | * [[RXN-1125]]
| + | |
| − | * [[RXN-10060]]
| + | |
| − | * [[GMP-REDUCT-RXN]]
| + | |
| − | * [[RXN-1121]]
| + | |
| − | * [[RXN1G-469]]
| + | |
| − | * [[3-HYDROXYBUTYRYL-COA-DEHYDROGENASE-RXN]]
| + | |
| − | * [[1.14.13.79-RXN]]
| + | |
| − | * [[DIENOYLCOAREDUCT-RXN]]
| + | |
| − | * [[DIHYDROFOLATEREDUCT-RXN]]
| + | |
| − | * [[RXN-14973]] | + | |
| − | * [[RXN-14972]] | + | |
| − | * [[1.1.1.271-RXN]] | + | |
| − | * [[RXN66-27]]
| + | |
| − | * [[GLUTAMATESYN-RXN]]
| + | |
| − | * [[RXN-7659]]
| + | |
| − | * [[RXN-7658]]
| + | |
| − | * [[RIBOFLAVINSYNREDUC-RXN]]
| + | |
| − | * [[RXN-12521]]
| + | |
| − | * [[FLAVONADPREDUCT-RXN]]
| + | |
| − | * [[RXN-10655]]
| + | |
| − | * [[PYRNUTRANSHYDROGEN-RXN]]
| + | |
| − | * [[RXN-10659]]
| + | |
| − | * [[RXN1G-163]]
| + | |
| − | * [[RXN-16097]]
| + | |
| − | * [[RXN-16095]]
| + | |
| − | * [[RXN-16622]]
| + | |
| − | * [[1.14.13.8-RXN]]
| + | |
| − | * [[2-DEHYDROPANTOATE-REDUCT-RXN]]
| + | |
| − | * [[RXN-8853]]
| + | |
| − | * [[RXN-14776]]
| + | |
| − | * [[TRANSENOYLCOARED-RXN]]
| + | |
| − | * [[RXN-13299]]
| + | |
| − | * [[GLYOXYLATE-REDUCTASE-NADP+-RXN]]
| + | |
| − | * [[RXN-16016]]
| + | |
| − | * [[RXN3O-130]]
| + | |
| − | * [[RXN66-13]]
| + | |
| − | * [[RXN66-11]]
| + | |
| − | * [[ACETOOHBUTREDUCTOISOM-RXN]] | + | |
| − | * [[RXN66-14]] | + | |
| − | * [[GLUTATHIONE-REDUCT-NADPH-RXN]] | + | |
| − | * [[RXN-15006]] | + | |
| − | * [[RXN-12747]] | + | |
| − | * [[RXN-7835]] | + | |
| − | * [[RXN-11476]]
| + | |
| − | * [[RXN-13961]] | + | |
| − | * [[RXN1G-240]]
| + | |
| − | * [[RXN-16630]]
| + | |
| − | * [[RXN66-305]]
| + | |
| − | * [[RXN66-304]]
| + | |
| − | * [[RXN66-306]]
| + | |
| − | * [[RXN-773]]
| + | |
| − | * [[RXN66-303]]
| + | |
| − | * [[DIHYDROFOLATEREDUCT-RXN-THF/NADP//DIHYDROFOLATE/NADPH/PROTON.37.]]
| + | |
| − | * [[SHIKIMATE-5-DEHYDROGENASE-RXN]]
| + | |
| − | * [[RXN-11480]] | + | |
| − | * [[NITRATE-REDUCTASE-NADPH-RXN]] | + | |
| − | * [[1.5.1.8-RXN]]
| + | |
| − | * [[RXN66-482]]
| + | |
| − | * [[3-OXOACYL-ACP-REDUCT-RXN]]
| + | |
| − | * [[RXN1G-72]]
| + | |
| − | * [[RXN66-81]]
| + | |
| − | * [[RXN-9725]]
| + | |
| − | * [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]]
| + | |
| − | * [[1.5.1.19-RXN]] | + | |
| − | * [[SULFITE-REDUCT-RXN]]
| + | |
| − | * [[RXN-16131]]
| + | |
| − | * [[RXN-16626]]
| + | |
| − | * [[RXN1F-160]]
| + | |
| − | * [[RXN1F-161]]
| + | |
| − | * [[RXN-9518]]
| + | |
| − | * [[RXN-4231]]
| + | |
| − | * [[RXN-9514]]
| + | |
| − | * [[RXN-9515]]
| + | |
| − | == Reaction(s) known to produce the compound ==
| + | |
| − | * [[TRANS-RXN0-277]]
| + | |
| − | * [[RXN-924]]
| + | |
| − | * [[RXN-9952]] | + | |
| − | * [[MALIC-NADP-RXN]] | + | |
| − | * [[ALDEHYDE-DEHYDROGENASE-NADP+-RXN]]
| + | |
| − | * [[RXN0-3962]]
| + | |
| − | * [[1.18.1.2-RXN]]
| + | |
| − | * [[RXN-5682]]
| + | |
| − | * [[BENZALDEHYDE-DEHYDROGENASE-NADP+-RXN]]
| + | |
| − | * [[GLU6PDEHYDROG-RXN]]
| + | |
| − | == Reaction(s) of unknown directionality == | + | |
| − | * [[ISOCITDEH-RXN]] | + | |
| − | * [[RXN-7911]] | + | |
| − | * [[RXN-1124]] | + | |
| − | * [[RXN1G-157]] | + | |
| − | * [[1.3.99.5-RXN]] | + | |
| − | * [[RXN-13008]] | + | |
| − | * [[GLUTDEHYD-RXN]]
| + | |
| − | * [[METHYLENETHFDEHYDROG-NADP-RXN]]
| + | |
| − | * [[RXN-8349_PLANTCYC]]
| + | |
| − | * [[1.1.1.34-RXN]]
| + | |
| − | * [[FATTY-ACID-SYNTHASE-RXN]]
| + | |
| − | * [[DXPREDISOM-RXN]]
| + | |
| − | * [[PREPHENATE-DEHYDROGENASE-NADP+-RXN]]
| + | |
| − | * [[RXN-15115]]
| + | |
| − | * [[FATTY-ACYL-COA-SYNTHASE-RXN]]
| + | |
| − | * [[RXN-9951]]
| + | |
| − | * [[RXN-701]]
| + | |
| − | * [[ACETOLACTREDUCTOISOM-RXN]]
| + | |
| − | * [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
| + | |
| − | * [[RXN1F-10]]
| + | |
| − | * [[GLYCEROL-DEHYDROGENASE-NADP+-RXN]]
| + | |
| − | * [[N-ACETYLGLUTPREDUCT-RXN]]
| + | |
| − | * [[LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN]]
| + | |
| − | * [[RXN-14209]]
| + | |
| | == External links == | | == External links == |
| − | * CAS : 2646-71-1 | + | * RHEA: |
| − | * BIGG : 33486
| + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18965 18965] |
| − | * PUBCHEM:
| + | * LIGAND-RXN: |
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15983949 15983949] | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03165 R03165] |
| − | * HMDB : HMDB00221
| + | * UNIPROT: |
| − | * LIGAND-CPD: | + | ** [http://www.uniprot.org/uniprot/P10746 P10746] |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?C00005 C00005] | + | ** [http://www.uniprot.org/uniprot/P51163 P51163] |
| − | * CHEMSPIDER: | + | ** [http://www.uniprot.org/uniprot/P21248 P21248] |
| − | ** [http://www.chemspider.com/Chemical-Structure.10239199.html 10239199] | + | ** [http://www.uniprot.org/uniprot/Q58401 Q58401] |
| − | * CHEBI: | + | ** [http://www.uniprot.org/uniprot/P09126 P09126] |
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57783 57783] | + | ** [http://www.uniprot.org/uniprot/Q59294 Q59294] |
| − | * METABOLIGHTS : MTBLC57783 | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | {{#set: smiles=C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))C=C(CC=5)C(=O)N)}} | + | {{#set: common name=uroporphyrinogen synthase, putative chloroplast precursor}} |
| − | {{#set: inchi key=InChIKey=ACFIXJIJDZMPPO-NNYOXOHSSA-J}} | + | {{#set: ec number=EC-4.2.1.75}} |
| − | {{#set: common name=NADPH}} | + | {{#set: gene associated=Ec-12_004890}} |
| − | {{#set: molecular weight=741.394 }} | + | {{#set: in pathway=PWY-5189|PWY-5188}} |
| − | {{#set: common name=reduced nicotinamide adenine dinucleotide phosphate|NADPH2|dihydrotriphosphopyridine nucleotide|reduced dihydrotriphosphopyridine nucleotide|dihydronicotinamide adenine dinucleotide phosphate|dihydronicotinamide adenine dinucleotide phosphate reduced|reduced NADP|NADP-red|TPNH|dihydronicotinamide adenine dinucleotide-P|β-NADPH}} | + | {{#set: reconstruction category=annotation}} |
| − | {{#set: consumed by=RXN-7660|RXN1G-1053|RXN-4144|RXN-7665|RXN-16616|RXN66-323|RXN-711|RXN-16129|RXN-715|RXN1G-349|RXN-7664|RXN-600|1.14.13.70-RXN|RXN-7666|THIOREDOXIN-REDUCT-NADPH-RXN|RXN-13307|RXN-17678|RXN-4225|RXN-9546|RXN66-12|RXN-17109|RXN-7677|RXN-7676|UDPNACETYLMURAMATEDEHYDROG-RXN|1.2.1.13-RXN|RXN-7784|RXN0-2142|RXN-13398|RXN1G-358|RXN-16114|RXN-16112|RXN-3142|RXN-15046|RXN-10625|GLUTSEMIALDEHYDROG-RXN|RXN1G-260|RXN1G-508|RXN-17428|RXN-13707|RXN-9536|RXN-9532|RXN-14014|RXN-11881|RXN-17111|RXN-1106|RXN1G-364|RXN-1102|RXN-1101|RXN1G-287|RXN-5285|RXN-9633|RXN-9524|RXN-9528|RXN1A0-6303|RXN0-1281|RXN-16765|RXN-14790|NADPH-DEHYDROGENASE-FLAVIN-RXN|GLUTRNAREDUCT-RXN|RXN-14715|RXN-9540|RXN-9556|RXN-13724|RXN-9552|RXN-707|RXN-13431|KYNURENINE-3-MONOOXYGENASE-RXN|RXN-4210|RXN1G-881|RXN-1125|RXN-10060|GMP-REDUCT-RXN|RXN-1121|RXN1G-469|3-HYDROXYBUTYRYL-COA-DEHYDROGENASE-RXN|1.14.13.79-RXN|DIENOYLCOAREDUCT-RXN|DIHYDROFOLATEREDUCT-RXN|RXN-14973|RXN-14972|1.1.1.271-RXN|RXN66-27|GLUTAMATESYN-RXN|RXN-7659|RXN-7658|RIBOFLAVINSYNREDUC-RXN|RXN-12521|FLAVONADPREDUCT-RXN|RXN-10655|PYRNUTRANSHYDROGEN-RXN|RXN-10659|RXN1G-163|RXN-16097|RXN-16095|RXN-16622|1.14.13.8-RXN|2-DEHYDROPANTOATE-REDUCT-RXN|RXN-8853|RXN-14776|TRANSENOYLCOARED-RXN|RXN-13299|GLYOXYLATE-REDUCTASE-NADP+-RXN|RXN-16016|RXN3O-130|RXN66-13|RXN66-11|ACETOOHBUTREDUCTOISOM-RXN|RXN66-14|GLUTATHIONE-REDUCT-NADPH-RXN|RXN-15006|RXN-12747|RXN-7835|RXN-11476|RXN-13961|RXN1G-240|RXN-16630|RXN66-305|RXN66-304|RXN66-306|RXN-773|RXN66-303|DIHYDROFOLATEREDUCT-RXN-THF/NADP//DIHYDROFOLATE/NADPH/PROTON.37.|SHIKIMATE-5-DEHYDROGENASE-RXN|RXN-11480|NITRATE-REDUCTASE-NADPH-RXN|1.5.1.8-RXN|RXN66-482|3-OXOACYL-ACP-REDUCT-RXN|RXN1G-72|RXN66-81|RXN-9725|DIHYDROKAEMPFEROL-4-REDUCTASE-RXN|1.5.1.19-RXN|SULFITE-REDUCT-RXN|RXN-16131|RXN-16626|RXN1F-160|RXN1F-161|RXN-9518|RXN-4231|RXN-9514|RXN-9515}} | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
| − | {{#set: produced by=TRANS-RXN0-277|RXN-924|RXN-9952|MALIC-NADP-RXN|ALDEHYDE-DEHYDROGENASE-NADP+-RXN|RXN0-3962|1.18.1.2-RXN|RXN-5682|BENZALDEHYDE-DEHYDROGENASE-NADP+-RXN|GLU6PDEHYDROG-RXN}} | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: consumed or produced by=ISOCITDEH-RXN|RXN-7911|RXN-1124|RXN1G-157|1.3.99.5-RXN|RXN-13008|GLUTDEHYD-RXN|METHYLENETHFDEHYDROG-NADP-RXN|RXN-8349_PLANTCYC|1.1.1.34-RXN|FATTY-ACID-SYNTHASE-RXN|DXPREDISOM-RXN|PREPHENATE-DEHYDROGENASE-NADP+-RXN|RXN-15115|FATTY-ACYL-COA-SYNTHASE-RXN|RXN-9951|RXN-701|ACETOLACTREDUCTOISOM-RXN|ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN|RXN1F-10|GLYCEROL-DEHYDROGENASE-NADP+-RXN|N-ACETYLGLUTPREDUCT-RXN|LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN|RXN-14209}} | + | |
Genes have been associated with this reaction based on different elements listed below.
