Difference between revisions of "CPD1F-95"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-95 CPD1F-95] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O)...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5132 PWY-5132] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-95 CPD1F-95] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3481 TAX-3481]
+
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
 +
* inchi key:
 +
** InChIKey=UJFQJDAESQJXTG-UFUZVNNQSA-L
 
* common name:
 
* common name:
−
** humulone biosynthesis
+
** gibberellin A12
 +
* molecular weight:
 +
** 330.423   
 
* Synonym(s):
 
* Synonym(s):
−
** Bitter α-acid (humulone) biosynthesis
+
** C20-GAs
 +
** open lactone gibberrellin skeleton
 +
** C20 skeleton
 +
** C20-GA skeleton
 +
** C20-gibberellin skeleton
 +
** GA12
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''2''' reactions found over '''4''' reactions in the full pathway
+
* [[RXN1F-162]]
−
* [[RXN-7810]]
+
== Reaction(s) known to produce the compound ==
−
* [[RXN-7811]]
+
* [[RXN1F-161]]
−
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
−
* [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.156-RXN 2.3.1.156-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7807 RXN-7807]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-3481}}
+
* LIPID_MAPS : LMPR0104170014
−
{{#set: common name=humulone biosynthesis}}
+
* PUBCHEM:
−
{{#set: common name=Bitter α-acid (humulone) biosynthesis}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244528 25244528]
−
{{#set: reaction found=2}}
+
* CHEBI:
−
{{#set: reaction not found=4}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58627 58627]
−
{{#set: completion rate=50.0}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C11857 C11857]
 +
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
 +
{{#set: inchi key=InChIKey=UJFQJDAESQJXTG-UFUZVNNQSA-L}}
 +
{{#set: common name=gibberellin A12}}
 +
{{#set: molecular weight=330.423    }}
 +
{{#set: common name=C20-GAs|open lactone gibberrellin skeleton|C20 skeleton|C20-GA skeleton|C20-gibberellin skeleton|GA12}}
 +
{{#set: consumed by=RXN1F-162}}
 +
{{#set: produced by=RXN1F-161}}

Latest revision as of 19:00, 21 March 2018

Metabolite CPD1F-95

  • smiles:
    • C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
  • inchi key:
    • InChIKey=UJFQJDAESQJXTG-UFUZVNNQSA-L
  • common name:
    • gibberellin A12
  • molecular weight:
    • 330.423
  • Synonym(s):
    • C20-GAs
    • open lactone gibberrellin skeleton
    • C20 skeleton
    • C20-GA skeleton
    • C20-gibberellin skeleton
    • GA12

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD1F-95&oldid=23836"