Difference between revisions of "CPD-4125"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4125 CPD-4125] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4125 CPD-4125] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
| + | * inchi key: | ||
| + | ** InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** avenasterol |
| + | * molecular weight: | ||
| + | ** 412.698 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-4209]] | |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * LIGAND- | + | * PUBCHEM: |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245230 25245230] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15782 C15782] |
| − | {{#set: | + | * HMDB : HMDB06851 |
| − | {{#set: | + | {{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N}} |
| + | {{#set: common name=avenasterol}} | ||
| + | {{#set: molecular weight=412.698 }} | ||
| + | {{#set: consumed by=RXN-4209}} | ||
Latest revision as of 19:03, 21 March 2018
Contents
Metabolite CPD-4125
- smiles:
- CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N
- common name:
- avenasterol
- molecular weight:
- 412.698
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
