Difference between revisions of "CPD-7109"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7109 CPD-7109] == * smiles: ** CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C * inchi key: **...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7102 PWY-7102] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7109 CPD-7109] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
+
* inchi key:
 +
** InChIKey=LWLGKGHHVBVDKB-UHFFFAOYSA-M
 
* common name:
 
* common name:
** bisabolene biosynthesis (engineered)
+
** 4-prenylphlorisovalerophenone
 +
* molecular weight:
 +
** 277.339   
 
* Synonym(s):
 
* Synonym(s):
 +
** PPIVP
 +
** compound-X
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''3''' reactions found over '''6''' reactions in the full pathway
+
* [[RXN-7810]]
* [[FPPSYN-RXN]]
+
== Reaction(s) known to produce the compound ==
* [[GPPSYN-RXN]]
+
* [[RXN-7811]]
* [[IPPISOM-RXN]]
+
== Reaction(s) of unknown directionality ==
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8429 RXN-8429]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8549 RXN-8549]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8550 RXN-8550]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2759}}
+
* PUBCHEM:
{{#set: taxonomic range=TAX-1224}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200610 25200610]
{{#set: common name=bisabolene biosynthesis (engineered)}}
+
{{#set: smiles=CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C}}
{{#set: reaction found=3}}
+
{{#set: inchi key=InChIKey=LWLGKGHHVBVDKB-UHFFFAOYSA-M}}
{{#set: reaction not found=6}}
+
{{#set: common name=4-prenylphlorisovalerophenone}}
{{#set: completion rate=50.0}}
+
{{#set: molecular weight=277.339    }}
 +
{{#set: common name=PPIVP|compound-X}}
 +
{{#set: consumed by=RXN-7810}}
 +
{{#set: produced by=RXN-7811}}

Latest revision as of 19:03, 21 March 2018

Metabolite CPD-7109

  • smiles:
    • CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C
  • inchi key:
    • InChIKey=LWLGKGHHVBVDKB-UHFFFAOYSA-M
  • common name:
    • 4-prenylphlorisovalerophenone
  • molecular weight:
    • 277.339
  • Synonym(s):
    • PPIVP
    • compound-X

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C" cannot be used as a page name in this wiki.