Difference between revisions of "CPD-7109"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7109 CPD-7109] == * smiles: ** CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C * inchi key: **...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7109 CPD-7109] == |
− | * | + | * smiles: |
− | ** [ | + | ** CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C |
− | ** | + | * inchi key: |
+ | ** InChIKey=LWLGKGHHVBVDKB-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** 4-prenylphlorisovalerophenone |
+ | * molecular weight: | ||
+ | ** 277.339 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** PPIVP | ||
+ | ** compound-X | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-7810]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-7811]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == Reaction(s) | + | |
− | * [ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200610 25200610] |
− | {{#set: common name= | + | {{#set: smiles=CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=LWLGKGHHVBVDKB-UHFFFAOYSA-M}} |
− | {{#set: | + | {{#set: common name=4-prenylphlorisovalerophenone}} |
− | {{#set: | + | {{#set: molecular weight=277.339 }} |
+ | {{#set: common name=PPIVP|compound-X}} | ||
+ | {{#set: consumed by=RXN-7810}} | ||
+ | {{#set: produced by=RXN-7811}} |
Latest revision as of 19:03, 21 March 2018
Contents
Metabolite CPD-7109
- smiles:
- CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C
- inchi key:
- InChIKey=LWLGKGHHVBVDKB-UHFFFAOYSA-M
- common name:
- 4-prenylphlorisovalerophenone
- molecular weight:
- 277.339
- Synonym(s):
- PPIVP
- compound-X
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C" cannot be used as a page name in this wiki.