Difference between revisions of "CPD-11552"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11552 CPD-11552] == * smiles: ** C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1) * inchi key: **...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7147 PWY-7147] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11552 CPD-11552] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1)
 +
* inchi key:
 +
** InChIKey=YCJNYHCCOXVYAF-UHFFFAOYSA-M
 
* common name:
 
* common name:
** 8-amino-7-oxononanoate biosynthesis II
+
** 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate
 +
* molecular weight:
 +
** 222.177   
 
* Synonym(s):
 
* Synonym(s):
** 7-keto-8-aminopelargonate biosynthesis II
 
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''1''' reactions found over '''2''' reactions in the full pathway
+
* [[RXN-10722]]
* [[RXN-11484]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13834 RXN-13834]
+
* [[RXN-10721]]
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2}}
+
* PUBCHEM:
{{#set: common name=8-amino-7-oxononanoate biosynthesis II}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145116 21145116]
{{#set: common name=7-keto-8-aminopelargonate biosynthesis II}}
+
* CHEMSPIDER:
{{#set: reaction found=1}}
+
** [http://www.chemspider.com/Chemical-Structure.20016009.html 20016009]
{{#set: reaction not found=2}}
+
* LIGAND-CPD:
{{#set: completion rate=50.0}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05645 C05645]
 +
* HMDB : HMDB04083
 +
{{#set: smiles=C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1)}}
 +
{{#set: inchi key=InChIKey=YCJNYHCCOXVYAF-UHFFFAOYSA-M}}
 +
{{#set: common name=4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate}}
 +
{{#set: molecular weight=222.177    }}
 +
{{#set: consumed by=RXN-10722}}
 +
{{#set: reversible reaction associated=RXN-10721}}

Latest revision as of 19:08, 21 March 2018

Metabolite CPD-11552

  • smiles:
    • C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1)
  • inchi key:
    • InChIKey=YCJNYHCCOXVYAF-UHFFFAOYSA-M
  • common name:
    • 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate
  • molecular weight:
    • 222.177
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1)" cannot be used as a page name in this wiki.