Difference between revisions of "CPD-14115"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14115 CPD-14115] == * smiles: ** C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O) * inchi key:...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14115 CPD-14115] == |
| − | * | + | * smiles: |
| − | ** | + | ** C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O) |
| − | ** | + | * inchi key: |
| + | ** InChIKey=ADFCQWZHKCXPAJ-GFCCVEGCSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** (S)-equol |
| + | * molecular weight: | ||
| + | ** 242.274 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 4',7-isoflavandiol | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-15589]] | |
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [ | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C14131 C14131] |
| − | {{#set: common name= | + | * Wikipedia : Equol |
| − | {{#set: | + | * HMDB : HMDB02209 |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=34741 34741] |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91469 91469] | ||
| + | {{#set: smiles=C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O)}} | ||
| + | {{#set: inchi key=InChIKey=ADFCQWZHKCXPAJ-GFCCVEGCSA-N}} | ||
| + | {{#set: common name=(S)-equol}} | ||
| + | {{#set: molecular weight=242.274 }} | ||
| + | {{#set: common name=4',7-isoflavandiol}} | ||
| + | {{#set: reversible reaction associated=RXN-15589}} | ||
Latest revision as of 19:08, 21 March 2018
Contents
Metabolite CPD-14115
- smiles:
- C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O)
- inchi key:
- InChIKey=ADFCQWZHKCXPAJ-GFCCVEGCSA-N
- common name:
- (S)-equol
- molecular weight:
- 242.274
- Synonym(s):
- 4',7-isoflavandiol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
