Difference between revisions of "CPD-4187"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4187 CPD-4187] == * smiles: ** CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4187 CPD-4187] == |
− | * | + | * smiles: |
− | ** [ | + | ** CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4)))) |
− | ** | + | * inchi key: |
+ | ** InChIKey=UCTLRSWJYQTBFZ-DDPQNLDTSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 7-dehydrocholesterol |
+ | * molecular weight: | ||
+ | ** 384.644 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** cholesta-5,7-dien-3 β-ol |
+ | ** cholesta-5,7-dienol | ||
+ | ** 7-dehydro-cholesterol | ||
+ | ** cholesta-5,7-dien-3β-ol | ||
+ | ** provitamin D3 | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN66-323]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[1.14.21.6-RXN]] | |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
== External links == | == External links == | ||
− | * | + | * CAS : 434-16-2 |
− | ** [http:// | + | * PUBCHEM: |
− | * | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201813 25201813] |
− | ** [http:// | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17759 17759] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01164 C01164] |
− | {{#set: | + | * HMDB : HMDB00032 |
− | {{#set: | + | {{#set: smiles=CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4))))}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=UCTLRSWJYQTBFZ-DDPQNLDTSA-N}} |
− | {{#set: | + | {{#set: common name=7-dehydrocholesterol}} |
+ | {{#set: molecular weight=384.644 }} | ||
+ | {{#set: common name=cholesta-5,7-dien-3 β-ol|cholesta-5,7-dienol|7-dehydro-cholesterol|cholesta-5,7-dien-3β-ol|provitamin D3}} | ||
+ | {{#set: consumed by=RXN66-323}} | ||
+ | {{#set: produced by=1.14.21.6-RXN}} |
Latest revision as of 19:08, 21 March 2018
Contents
Metabolite CPD-4187
- smiles:
- CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4))))
- inchi key:
- InChIKey=UCTLRSWJYQTBFZ-DDPQNLDTSA-N
- common name:
- 7-dehydrocholesterol
- molecular weight:
- 384.644
- Synonym(s):
- cholesta-5,7-dien-3 β-ol
- cholesta-5,7-dienol
- 7-dehydro-cholesterol
- cholesta-5,7-dien-3β-ol
- provitamin D3
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4))))" cannot be used as a page name in this wiki.