Difference between revisions of "CPD-7414"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7414 CPD-7414] == * smiles: ** CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7414 CPD-7414] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=QABFXOMOOYWZLZ-GDBZIMIPSA-N |
* common name: | * common name: | ||
| − | ** | + | ** ε-carotene |
| + | * molecular weight: | ||
| + | ** 536.882 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** ε,ε-carotene | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * [[ | + | * [[RXN-8028]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | == Reaction(s) | + | |
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12358808 12358808] |
| − | + | * LIGAND-CPD: | |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16276 C16276] |
| − | {{#set: | + | {{#set: smiles=CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2)}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=QABFXOMOOYWZLZ-GDBZIMIPSA-N}} |
| − | {{#set: | + | {{#set: common name=ε-carotene}} |
| − | {{#set: | + | {{#set: molecular weight=536.882 }} |
| − | {{#set: | + | {{#set: common name=ε,ε-carotene}} |
| + | {{#set: produced by=RXN-8028}} | ||
Latest revision as of 19:17, 21 March 2018
Contents
Metabolite CPD-7414
- smiles:
- CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2)
- inchi key:
- InChIKey=QABFXOMOOYWZLZ-GDBZIMIPSA-N
- common name:
- ε-carotene
- molecular weight:
- 536.882
- Synonym(s):
- ε,ε-carotene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
