Difference between revisions of "3.1.26.4-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PREPHENATE PREPHENATE] == * smiles: ** C(=O)([O-])C(=O)CC1(C(=O)[O-])(C=CC(O)C=C1) * inchi key:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.26.4-RXN 3.1.26.4-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** RNA-DNA hybrid ribonu...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.26.4-RXN 3.1.26.4-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** RNA-DNA hybrid ribonuclease |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.1.26.4 EC-3.1.26.4] |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** n [[WATER]][c] '''+''' 1 [[RNA-DNA-hybrids]][c] '''=>''' 1 [[DNA-Holder]][c] '''+''' n [[Nucleoside-Monophosphates]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** n H2O[c] '''+''' 1 a RNA-DNA hybrid[c] '''=>''' 1 DNA[c] '''+''' n a nucleoside 5'-monophosphate[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[Ec-25_002560]] |
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-17_003740]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-22_003570]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P52975 P52975] |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/Q9CDG3 Q9CDG3] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9PM39 Q9PM39] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9JX40 Q9JX40] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P43807 P43807] |
− | * | + | ** [http://www.uniprot.org/uniprot/P43808 P43808] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9PJA1 Q9PJA1] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9CG17 Q9CG17] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9JTD9 Q9JTD9] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q57599 Q57599] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O44114 O44114] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P0A7Y4 P0A7Y4] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P10442 P10442] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P13319 P13319] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q7LYY8 Q7LYY8] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P0A2B9 P0A2B9] |
+ | ** [http://www.uniprot.org/uniprot/Q04740 Q04740] | ||
+ | ** [http://www.uniprot.org/uniprot/Q49050 Q49050] | ||
+ | ** [http://www.uniprot.org/uniprot/O69014 O69014] | ||
+ | ** [http://www.uniprot.org/uniprot/Q54222 Q54222] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=RNA-DNA hybrid ribonuclease}} | ||
+ | {{#set: ec number=EC-3.1.26.4}} | ||
+ | {{#set: gene associated=Ec-25_002560|Ec-17_003740|Ec-22_003570}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:05, 21 March 2018
Contents
Reaction 3.1.26.4-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- RNA-DNA hybrid ribonuclease
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- n WATER[c] + 1 RNA-DNA-hybrids[c] => 1 DNA-Holder[c] + n Nucleoside-Monophosphates[c]
- With common name(s):
- n H2O[c] + 1 a RNA-DNA hybrid[c] => 1 DNA[c] + n a nucleoside 5'-monophosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-25_002560
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-17_003740
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-22_003570
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- UNIPROT: