Difference between revisions of "PWY-5366"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFO-CYSTEINE SULFO-CYSTEINE] == * smiles: ** C(C([N+])C(=O)[O-])SS([O-])(=O)=O * inchi key: *...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5366 PWY-5366] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFO-CYSTEINE SULFO-CYSTEINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5366 PWY-5366] ==
* smiles:
+
* taxonomic range:
** C(C([N+])C(=O)[O-])SS([O-])(=O)=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=NOKPBJYHPHHWAN-REOHCLBHSA-M
+
 
* common name:
 
* common name:
** S-sulfo-L-cysteine
+
** palmitoleate biosynthesis II (plants and bacteria)
* molecular weight:
+
** 200.204   
+
 
* Synonym(s):
 
* Synonym(s):
** S-sulfocysteine
+
** palmitoleic acid biosynthesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[RXN-9550]]
* [[SULFOCYS-RXN]]
+
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8389 RXN-8389]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2759}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203408 25203408]
+
{{#set: taxonomic range=TAX-2}}
* CHEBI:
+
{{#set: common name=palmitoleate biosynthesis II (plants and bacteria)}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62225 62225]
+
{{#set: common name=palmitoleic acid biosynthesis}}
* LIGAND-CPD:
+
{{#set: reaction found=1}}
** [http://www.genome.jp/dbget-bin/www_bget?C05824 C05824]
+
{{#set: total reaction=2}}
* HMDB : HMDB00731
+
{{#set: completion rate=50.0}}
{{#set: smiles=C(C([N+])C(=O)[O-])SS([O-])(=O)=O}}
+
{{#set: inchi key=InChIKey=NOKPBJYHPHHWAN-REOHCLBHSA-M}}
+
{{#set: common name=S-sulfo-L-cysteine}}
+
{{#set: molecular weight=200.204    }}
+
{{#set: common name=S-sulfocysteine}}
+
{{#set: consumed or produced by=SULFOCYS-RXN}}
+

Latest revision as of 19:05, 21 March 2018

Pathway PWY-5366

  • taxonomic range:
  • common name:
    • palmitoleate biosynthesis II (plants and bacteria)
  • Synonym(s):
    • palmitoleic acid biosynthesis

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links