Difference between revisions of "CPD1G-120"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-120 CPD1G-120] == * smiles: ** C(O)C2(C(C(C(NC(=O)C([N+])CS)C(OC1(C(O)C(O)C(O)C(O)C(O)1))...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-120 CPD1G-120] == |
− | * | + | * smiles: |
− | ** [ | + | ** C(O)C2(C(C(C(NC(=O)C([N+])CS)C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O) |
+ | * inchi key: | ||
+ | ** InChIKey=ZGXSCMBZZVXWGF-BSEFFJTHSA-O | ||
* common name: | * common name: | ||
− | ** | + | ** deacetylmycothiol |
+ | * molecular weight: | ||
+ | ** 445.461 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 1-D-myo-inosityl-2-(L-cysteinyl)amido-2-deoxy-α-D-glucopyranoside |
+ | ** Cys-GlcN-Ins | ||
+ | ** 3-O-(2-L-cysteinamido-2-deoxy-alpha-D-glucopyranosyl)-1D-myo-inositol | ||
+ | ** desacetylmycothiol | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | * [[ | + | * [[RXN1G-121]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | == Reaction(s) | + | |
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878469 46878469] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58887 58887] |
− | {{#set: common name= | + | {{#set: smiles=C(O)C2(C(C(C(NC(=O)C([N+])CS)C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O)}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=ZGXSCMBZZVXWGF-BSEFFJTHSA-O}} |
− | {{#set: | + | {{#set: common name=deacetylmycothiol}} |
− | {{#set: | + | {{#set: molecular weight=445.461 }} |
+ | {{#set: common name=1-D-myo-inosityl-2-(L-cysteinyl)amido-2-deoxy-α-D-glucopyranoside|Cys-GlcN-Ins|3-O-(2-L-cysteinamido-2-deoxy-alpha-D-glucopyranosyl)-1D-myo-inositol|desacetylmycothiol}} | ||
+ | {{#set: produced by=RXN1G-121}} |
Latest revision as of 19:23, 21 March 2018
Contents
Metabolite CPD1G-120
- smiles:
- C(O)C2(C(C(C(NC(=O)C([N+])CS)C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O)
- inchi key:
- InChIKey=ZGXSCMBZZVXWGF-BSEFFJTHSA-O
- common name:
- deacetylmycothiol
- molecular weight:
- 445.461
- Synonym(s):
- 1-D-myo-inosityl-2-(L-cysteinyl)amido-2-deoxy-α-D-glucopyranoside
- Cys-GlcN-Ins
- 3-O-(2-L-cysteinamido-2-deoxy-alpha-D-glucopyranosyl)-1D-myo-inositol
- desacetylmycothiol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C2(C(C(C(NC(=O)C([N+])CS)C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O)" cannot be used as a page name in this wiki.