Difference between revisions of "CPD1G-120"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-120 CPD1G-120] == * smiles: ** C(O)C2(C(C(C(NC(=O)C([N+])CS)C(OC1(C(O)C(O)C(O)C(O)C(O)1))...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6897 PWY-6897] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-120 CPD1G-120] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** C(O)C2(C(C(C(NC(=O)C([N+])CS)C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O)
 +
* inchi key:
 +
** InChIKey=ZGXSCMBZZVXWGF-BSEFFJTHSA-O
 
* common name:
 
* common name:
** thiamine salvage II
+
** deacetylmycothiol
 +
* molecular weight:
 +
** 445.461   
 
* Synonym(s):
 
* Synonym(s):
** thiamin salvage II
+
** 1-D-myo-inosityl-2-(L-cysteinyl)amido-2-deoxy-α-D-glucopyranoside
 +
** Cys-GlcN-Ins
 +
** 3-O-(2-L-cysteinamido-2-deoxy-alpha-D-glucopyranosyl)-1D-myo-inositol
 +
** desacetylmycothiol
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''3''' reactions found over '''5''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[PWY-6910]]
+
* [[RXN1G-121]]
* [[THI-P-SYN-RXN]]
+
== Reaction(s) of unknown directionality ==
* [[THIAZOLSYN3-RXN]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=THI-P-KIN-RXN THI-P-KIN-RXN]
+
 
== External links  ==
 
== External links  ==
* ECOCYC:
+
* PUBCHEM:
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6897 PWY-6897]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878469 46878469]
{{#set: taxonomic range=TAX-2}}
+
* CHEBI:
{{#set: common name=thiamine salvage II}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58887 58887]
{{#set: common name=thiamin salvage II}}
+
{{#set: smiles=C(O)C2(C(C(C(NC(=O)C([N+])CS)C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O)}}
{{#set: reaction found=3}}
+
{{#set: inchi key=InChIKey=ZGXSCMBZZVXWGF-BSEFFJTHSA-O}}
{{#set: reaction not found=5}}
+
{{#set: common name=deacetylmycothiol}}
{{#set: completion rate=60.0}}
+
{{#set: molecular weight=445.461    }}
 +
{{#set: common name=1-D-myo-inosityl-2-(L-cysteinyl)amido-2-deoxy-α-D-glucopyranoside|Cys-GlcN-Ins|3-O-(2-L-cysteinamido-2-deoxy-alpha-D-glucopyranosyl)-1D-myo-inositol|desacetylmycothiol}}
 +
{{#set: produced by=RXN1G-121}}

Latest revision as of 19:23, 21 March 2018

Metabolite CPD1G-120

  • smiles:
    • C(O)C2(C(C(C(NC(=O)C([N+])CS)C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O)
  • inchi key:
    • InChIKey=ZGXSCMBZZVXWGF-BSEFFJTHSA-O
  • common name:
    • deacetylmycothiol
  • molecular weight:
    • 445.461
  • Synonym(s):
    • 1-D-myo-inosityl-2-(L-cysteinyl)amido-2-deoxy-α-D-glucopyranoside
    • Cys-GlcN-Ins
    • 3-O-(2-L-cysteinamido-2-deoxy-alpha-D-glucopyranosyl)-1D-myo-inositol
    • desacetylmycothiol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C2(C(C(C(NC(=O)C([N+])CS)C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O)" cannot be used as a page name in this wiki.