Difference between revisions of "CPD-8121"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8121 CPD-8121] == * smiles: ** CCC=CCC=CCC=CCC=CCCCCCCC([O-])=O * common name: ** icosatetr...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8121 CPD-8121] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CCC=CCC=CCC=CCC=CCCCCCCC([O-])=O |
* common name: | * common name: | ||
| − | ** | + | ** icosatetraenoate |
| + | * inchi key: | ||
| + | ** InChIKey=HQPCSDADVLFHHO-LTKCOYKYSA-M | ||
| + | * molecular weight: | ||
| + | ** 303.464 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** (8Z,11Z,14Z,17Z)-eicosatetraenoic acid | ||
| + | ** (8Z,11Z,14Z,17Z)-eicosatetraenoate | ||
| + | ** (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoate | ||
| + | ** ETA | ||
| + | ** eicosatetraenoate | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-8349_PLANTCYC]] | |
| − | + | ||
| − | == Reaction(s) | + | |
| − | * [ | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71563 71563] |
| − | {{#set: | + | * HMDB : HMDB02177 |
| − | {{#set: | + | * Wikipedia : Eicosatetraenoic_acid |
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244091 25244091] | ||
| + | {{#set: smiles=CCC=CCC=CCC=CCC=CCCCCCCC([O-])=O}} | ||
| + | {{#set: common name=icosatetraenoate}} | ||
| + | {{#set: inchi key=InChIKey=HQPCSDADVLFHHO-LTKCOYKYSA-M}} | ||
| + | {{#set: molecular weight=303.464 }} | ||
| + | {{#set: common name=(8Z,11Z,14Z,17Z)-eicosatetraenoic acid|(8Z,11Z,14Z,17Z)-eicosatetraenoate|(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoate|ETA|eicosatetraenoate}} | ||
| + | {{#set: reversible reaction associated=RXN-8349_PLANTCYC}} | ||
Latest revision as of 19:27, 21 March 2018
Contents
Metabolite CPD-8121
- smiles:
- CCC=CCC=CCC=CCC=CCCCCCCC([O-])=O
- common name:
- icosatetraenoate
- inchi key:
- InChIKey=HQPCSDADVLFHHO-LTKCOYKYSA-M
- molecular weight:
- 303.464
- Synonym(s):
- (8Z,11Z,14Z,17Z)-eicosatetraenoic acid
- (8Z,11Z,14Z,17Z)-eicosatetraenoate
- (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoate
- ETA
- eicosatetraenoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCC=CCCCCCCC([O-])=O" cannot be used as a page name in this wiki.
