Difference between revisions of "CPD-9852"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9852 CPD-9852] == * smiles: ** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7725 PWY-7725] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9852 CPD-9852] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C
 +
* inchi key:
 +
** InChIKey=PEMFGDIFKKXFRG-PYHSYOTJSA-M
 
* common name:
 
* common name:
** arachidonate biosynthesis V (8-detaturase, mammals)
+
** 3-heptaprenyl-4-hydroxybenzoate
 +
* molecular weight:
 +
** 613.942   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''5''' reactions found over '''6''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[RXN-16094]]
+
* [[RXN-9222]]
* [[RXN-16095]]
+
== Reaction(s) of unknown directionality ==
* [[RXN-16096]]
+
* [[RXN-16097]]
+
* [[RXN-17105]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16064 RXN-16064]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2759}}
+
* PUBCHEM:
{{#set: common name=arachidonate biosynthesis V (8-detaturase, mammals)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54740346 54740346]
{{#set: reaction found=5}}
+
* CHEBI:
{{#set: reaction not found=6}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84496 84496]
{{#set: completion rate=83.0}}
+
{{#set: smiles=CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C}}
 +
{{#set: inchi key=InChIKey=PEMFGDIFKKXFRG-PYHSYOTJSA-M}}
 +
{{#set: common name=3-heptaprenyl-4-hydroxybenzoate}}
 +
{{#set: molecular weight=613.942    }}
 +
{{#set: produced by=RXN-9222}}

Latest revision as of 19:32, 21 March 2018

Metabolite CPD-9852

  • smiles:
    • CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C
  • inchi key:
    • InChIKey=PEMFGDIFKKXFRG-PYHSYOTJSA-M
  • common name:
    • 3-heptaprenyl-4-hydroxybenzoate
  • molecular weight:
    • 613.942
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C" cannot be used as a page name in this wiki.