Difference between revisions of "CPD-4702"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4702 CPD-4702] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5177 PWY-5177] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4702 CPD-4702] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
+
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
* inchi key:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M
 
* common name:
 
* common name:
** glutaryl-CoA degradation
+
** 4α-carboxy-5α-cholesta-8,24-dien-3β-ol
 +
* molecular weight:
 +
** 427.646   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''3''' reactions found over '''5''' reactions in the full pathway
+
* [[RXN66-318]]
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
+
== Reaction(s) known to produce the compound ==
* [[RXN-11662]]
+
== Reaction(s) of unknown directionality ==
* [[RXN-11667]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=GLUTACONYL-COA-DECARBOXYLASE-RXN GLUTACONYL-COA-DECARBOXYLASE-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=GLUTARYL-COA-DEHYDROG-RXN GLUTARYL-COA-DEHYDROG-RXN]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-33208}}
+
* PUBCHEM:
{{#set: taxonomic range=TAX-4751}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659076 90659076]
{{#set: taxonomic range=TAX-2}}
+
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))}}
{{#set: common name=glutaryl-CoA degradation}}
+
{{#set: inchi key=InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M}}
{{#set: reaction found=3}}
+
{{#set: common name=4α-carboxy-5α-cholesta-8,24-dien-3β-ol}}
{{#set: reaction not found=5}}
+
{{#set: molecular weight=427.646    }}
{{#set: completion rate=60.0}}
+
{{#set: consumed by=RXN66-318}}

Latest revision as of 19:33, 21 March 2018

Metabolite CPD-4702

  • smiles:
    • CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))
  • inchi key:
    • InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M
  • common name:
    • 4α-carboxy-5α-cholesta-8,24-dien-3β-ol
  • molecular weight:
    • 427.646
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.