Difference between revisions of "Ec-06 009670"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8678 CPD-8678] == * smiles: ** CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO * inchi key: ** InChIKey=R...") |
(Created page with "Category:Gene == Gene Ec-06_009670 == * left end position: ** 7462961 * transcription direction: ** POSITIVE * right end position: ** 7467137 * centisome position: ** 85.2...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-06_009670 == |
− | * | + | * left end position: |
− | ** | + | ** 7462961 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 7467137 |
− | * | + | * centisome position: |
− | ** | + | ** 85.21542 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0086_0068 |
− | ** | + | ** Esi0086_0068 |
− | == | + | == Reactions associated == |
− | + | * Reaction: [[SQUALENE-MONOOXYGENASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
+ | * [[PWY-5670]] | ||
+ | * [[PWY-6098]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=7462961}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=7467137}} | |
− | + | {{#set: centisome position=85.21542 }} | |
− | + | {{#set: common name=Esi_0086_0068|Esi0086_0068}} | |
− | + | {{#set: reaction associated=SQUALENE-MONOOXYGENASE-RXN}} | |
− | {{#set: | + | {{#set: pathway associated=PWY-5670|PWY-6098}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:05, 21 March 2018
Gene Ec-06_009670
- left end position:
- 7462961
- transcription direction:
- POSITIVE
- right end position:
- 7467137
- centisome position:
- 85.21542
- Synonym(s):
- Esi_0086_0068
- Esi0086_0068
Reactions associated
- Reaction: SQUALENE-MONOOXYGENASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome