Difference between revisions of "CPD0-1107"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7234 PWY-7234] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1107 CPD0-1107] == * smiles: ** CC1(OC(C(C(C1O)O)O)O) * inchi key: ** InChIKey=SHZGCJCMOBC...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7234 PWY-7234] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1107 CPD0-1107] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
** CC1(OC(C(C(C1O)O)O)O)
 +
* inchi key:
 +
** InChIKey=SHZGCJCMOBCMKK-KGJVWPDLSA-N
 
* common name:
 
* common name:
−
** inosine-5'-phosphate biosynthesis III
+
** β-L-fucopyranose
 +
* molecular weight:
 +
** 164.158   
 
* Synonym(s):
 
* Synonym(s):
−
** IMP biosynthesis I
+
** β-L-fucose
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''3''' reactions found over '''6''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[AICARSYN-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** 1 associated gene(s):
+
* [[RXN0-5298]]
−
*** [[Ec-11_002070]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[IMPCYCLOHYDROLASE-RXN]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-11_005390]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[SAICARSYN-RXN]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10066 RXN-10066]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-742 RXN0-742]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-743 RXN0-743]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-2157}}
+
* DRUGBANK : DB03283
−
{{#set: common name=inosine-5'-phosphate biosynthesis III}}
+
* PUBCHEM:
−
{{#set: common name=IMP biosynthesis I}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=444863 444863]
−
{{#set: reaction found=3}}
+
* HMDB : HMDB59625
−
{{#set: total reaction=6}}
+
* LIGAND-CPD:
−
{{#set: completion rate=50.0}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01019 C01019]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.392667.html 392667]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42589 42589]
 +
{{#set: smiles=CC1(OC(C(C(C1O)O)O)O)}}
 +
{{#set: inchi key=InChIKey=SHZGCJCMOBCMKK-KGJVWPDLSA-N}}
 +
{{#set: common name=β-L-fucopyranose}}
 +
{{#set: molecular weight=164.158    }}
 +
{{#set: common name=β-L-fucose}}
 +
{{#set: reversible reaction associated=RXN0-5298}}

Latest revision as of 18:59, 21 March 2018

Metabolite CPD0-1107

  • smiles:
    • CC1(OC(C(C(C1O)O)O)O)
  • inchi key:
    • InChIKey=SHZGCJCMOBCMKK-KGJVWPDLSA-N
  • common name:
    • β-L-fucopyranose
  • molecular weight:
    • 164.158
  • Synonym(s):
    • β-L-fucose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD0-1107&oldid=23650"