Difference between revisions of "Ec-09 004230"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16819 CPD-16819] == * smiles: ** CC1(C=CC(=CC=1)OS(=O)(=O)[O-]) * inchi key: ** InChIKey=WG...") |
(Created page with "Category:Gene == Gene Ec-09_004230 == * left end position: ** 4762194 * transcription direction: ** NEGATIVE * right end position: ** 4767531 * centisome position: ** 84.8...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-09_004230 == |
− | * | + | * left end position: |
− | ** | + | ** 4762194 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4767531 |
− | * | + | * centisome position: |
− | ** | + | ** 84.83979 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0049_0120 |
+ | ** Esi0049_0120 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[4.2.2.10-RXN]] | |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: automated-name-match |
+ | * Reaction: [[RXN-14897]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7243]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4762194}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4767531}} | |
− | + | {{#set: centisome position=84.83979 }} | |
− | + | {{#set: common name=Esi_0049_0120|Esi0049_0120}} | |
− | {{#set: | + | {{#set: reaction associated=4.2.2.10-RXN|RXN-14897}} |
− | {{#set: | + | {{#set: pathway associated=PWY-7243}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 18:59, 21 March 2018
Gene Ec-09_004230
- left end position:
- 4762194
- transcription direction:
- NEGATIVE
- right end position:
- 4767531
- centisome position:
- 84.83979
- Synonym(s):
- Esi_0049_0120
- Esi0049_0120
Reactions associated
- Reaction: 4.2.2.10-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-14897
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome