Difference between revisions of "Ec-09 004230"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16819 CPD-16819] == * smiles: ** CC1(C=CC(=CC=1)OS(=O)(=O)[O-]) * inchi key: ** InChIKey=WG...")
(Created page with "Category:Gene == Gene Ec-09_004230 == * left end position: ** 4762194 * transcription direction: ** NEGATIVE * right end position: ** 4767531 * centisome position: ** 84.8...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16819 CPD-16819] ==
+
== Gene Ec-09_004230 ==
* smiles:
+
* left end position:
** CC1(C=CC(=CC=1)OS(=O)(=O)[O-])
+
** 4762194
* inchi key:
+
* transcription direction:
** InChIKey=WGNAKZGUSRVWRH-UHFFFAOYSA-M
+
** NEGATIVE
* common name:
+
* right end position:
** 4-methylphenyl sulfate
+
** 4767531
* molecular weight:
+
* centisome position:
** 187.19    
+
** 84.83979    
 
* Synonym(s):
 
* Synonym(s):
** p-cresol sulfate
+
** Esi_0049_0120
 +
** Esi0049_0120
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[4.2.2.10-RXN]]
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
* [[RXN-15588]]
+
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-14897]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7243]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=4762194}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4615422 4615422]
+
{{#set: transcription direction=NEGATIVE}}
* CHEMSPIDER:
+
{{#set: right end position=4767531}}
** [http://www.chemspider.com/Chemical-Structure.3806481.html 3806481]
+
{{#set: centisome position=84.83979   }}
* HMDB : HMDB11635
+
{{#set: common name=Esi_0049_0120|Esi0049_0120}}
{{#set: smiles=CC1(C=CC(=CC=1)OS(=O)(=O)[O-])}}
+
{{#set: reaction associated=4.2.2.10-RXN|RXN-14897}}
{{#set: inchi key=InChIKey=WGNAKZGUSRVWRH-UHFFFAOYSA-M}}
+
{{#set: pathway associated=PWY-7243}}
{{#set: common name=4-methylphenyl sulfate}}
+
{{#set: molecular weight=187.19   }}
+
{{#set: common name=p-cresol sulfate}}
+
{{#set: reversible reaction associated=RXN-15588}}
+

Latest revision as of 18:59, 21 March 2018

Gene Ec-09_004230

  • left end position:
    • 4762194
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4767531
  • centisome position:
    • 84.83979
  • Synonym(s):
    • Esi_0049_0120
    • Esi0049_0120

Reactions associated

Pathways associated

External links