Difference between revisions of "RXN-14642"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1242 CPD-1242] == * smiles: ** C(O)C1(OC(C(C(C1O)=O)O)O) * inchi key: ** InChIKey=APIQNBNBI...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14642 RXN-14642] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14642 RXN-14642] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/1.2.1 EC-1.2.1] | |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | * [[ | + | ** 1 [[Acceptor]][c] '''+''' 1 [[GLYCOLALDEHYDE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[GLYCOLLATE]][c] '''+''' 1 [[Donor-H2]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 an oxidized unknown electron acceptor[c] '''+''' 1 glycolaldehyde[c] '''=>''' 1 H+[c] '''+''' 1 glycolate[c] '''+''' 1 an reduced unknown electron acceptor[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | * [[PWY-7295]], L-arabinose degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7295 PWY-7295] | ||
| + | ** '''3''' reactions found over '''8''' reactions in the full pathway | ||
| + | * [[PWY-7294]], xylose degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7294 PWY-7294] | ||
| + | ** '''3''' reactions found over '''7''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[gap-filling]] | ||
| + | ** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
| + | *** Tool: [[meneco]] | ||
| + | **** Comment: [[added for gapfilling]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-1.2.1}} | |
| − | + | {{#set: in pathway=PWY-7295|PWY-7294}} | |
| − | + | {{#set: reconstruction category=gap-filling}} | |
| − | + | {{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}} | |
| − | + | {{#set: reconstruction tool=meneco}} | |
| − | + | {{#set: reconstruction comment=added for gapfilling}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 18:59, 21 March 2018
Contents
Reaction RXN-14642
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Acceptor[c] + 1 GLYCOLALDEHYDE[c] => 1 PROTON[c] + 1 GLYCOLLATE[c] + 1 Donor-H2[c]
- With common name(s):
- 1 an oxidized unknown electron acceptor[c] + 1 glycolaldehyde[c] => 1 H+[c] + 1 glycolate[c] + 1 an reduced unknown electron acceptor[c]
Genes associated with this reaction
Pathways
- PWY-7295, L-arabinose degradation IV: PWY-7295
- 3 reactions found over 8 reactions in the full pathway
- PWY-7294, xylose degradation IV: PWY-7294
- 3 reactions found over 7 reactions in the full pathway
Reconstruction information
- Category: gap-filling
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
- Tool: meneco
- Comment: added for gapfilling
- Tool: meneco
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
