Difference between revisions of "PWY-5939"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2244 CPD0-2244] == * smiles: ** CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5939 PWY-5939] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2244 CPD0-2244] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5939 PWY-5939] ==
* smiles:
+
* taxonomic range:
** CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J
+
 
* common name:
 
* common name:
** (S)-3-hydroxydecanoyl-CoA
+
** (R)-acetoin biosynthesis II
* molecular weight:
+
** 933.753   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** D-acetoin biosynthesis II
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-12490]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[ACETOLACTSYN-RXN]]
* [[RXN-13616]]
+
** 0 associated gene:
== Reaction(s) of unknown directionality ==
+
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=ACETOLACTATE-DECARBOXYLASE-RXN ACETOLACTATE-DECARBOXYLASE-RXN]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.genome.jp/dbget-bin/www_bget?C05264 C05264]
+
{{#set: common name=(R)-acetoin biosynthesis II}}
* CHEBI:
+
{{#set: common name=D-acetoin biosynthesis II}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62616 62616]
+
{{#set: reaction found=1}}
* BIGG : 45455
+
{{#set: total reaction=2}}
* PUBCHEM:
+
{{#set: completion rate=50.0}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859629 49859629]
+
* HMDB : HMDB03938
+
{{#set: smiles=CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}}
+
{{#set: inchi key=InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J}}
+
{{#set: common name=(S)-3-hydroxydecanoyl-CoA}}
+
{{#set: molecular weight=933.753    }}
+
{{#set: consumed by=RXN-12490}}
+
{{#set: produced by=RXN-13616}}
+

Latest revision as of 20:00, 21 March 2018

Pathway PWY-5939

  • taxonomic range:
  • common name:
    • (R)-acetoin biosynthesis II
  • Synonym(s):
    • D-acetoin biosynthesis II

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links