Difference between revisions of "CPD-85"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-19_000900 == * left end position: ** 1079471 * transcription direction: ** POSITIVE * right end position: ** 1089376 * centisome position: ** 18.0...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-85 CPD-85] == * smiles: ** CSCCC(C([O-])=CO)=O * inchi key: ** InChIKey=CILXJJLQPTUUSS-XQRV...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-19_000900 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-85 CPD-85] ==
−
* left end position:
+
* smiles:
−
** 1079471
+
** CSCCC(C([O-])=CO)=O
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=CILXJJLQPTUUSS-XQRVVYSFSA-M
−
* right end position:
+
* common name:
−
** 1089376
+
** 1,2-dihydroxy-5-(methylthio)pent-1-en-3-one
−
* centisome position:
+
* molecular weight:
−
** 18.079508    
+
** 161.195    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0054_0006
+
** 1,2-dihydroxy-3-keto-5-methylthiopentene anion
−
** Esi0054_0006
+
** 1,2-dihydroxy-3-keto-5-methylthiopentane
−
** LysRS
+
** 1,2-dihydroxy-3-keto-5-methylthiopentene
 +
** acireductone
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[LYSINE--TRNA-LIGASE-RXN]]
+
* [[R147-RXN]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
−
* [[TRNA-CHARGING-PWY]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=1079471}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229177 44229177]
−
{{#set: right end position=1089376}}
+
* CHEBI:
−
{{#set: centisome position=18.079508   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58795 58795]
−
{{#set: common name=Esi_0054_0006|Esi0054_0006|LysRS}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=LYSINE--TRNA-LIGASE-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15606 C15606]
−
{{#set: pathway associated=TRNA-CHARGING-PWY}}
+
* HMDB : HMDB12134
 +
{{#set: smiles=CSCCC(C([O-])=CO)=O}}
 +
{{#set: inchi key=InChIKey=CILXJJLQPTUUSS-XQRVVYSFSA-M}}
 +
{{#set: common name=1,2-dihydroxy-5-(methylthio)pent-1-en-3-one}}
 +
{{#set: molecular weight=161.195   }}
 +
{{#set: common name=1,2-dihydroxy-3-keto-5-methylthiopentene anion|1,2-dihydroxy-3-keto-5-methylthiopentane|1,2-dihydroxy-3-keto-5-methylthiopentene|acireductone}}
 +
{{#set: consumed by=R147-RXN}}

Latest revision as of 19:00, 21 March 2018

Metabolite CPD-85

  • smiles:
    • CSCCC(C([O-])=CO)=O
  • inchi key:
    • InChIKey=CILXJJLQPTUUSS-XQRVVYSFSA-M
  • common name:
    • 1,2-dihydroxy-5-(methylthio)pent-1-en-3-one
  • molecular weight:
    • 161.195
  • Synonym(s):
    • 1,2-dihydroxy-3-keto-5-methylthiopentene anion
    • 1,2-dihydroxy-3-keto-5-methylthiopentane
    • 1,2-dihydroxy-3-keto-5-methylthiopentene
    • acireductone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CSCCC(C([O-])=CO)=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-85&oldid=23730"