Difference between revisions of "PWY-5913"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE_ACETALDEHYDE INDOLE_ACETALDEHYDE] == * smiles: ** C(CC1(C2(=C(NC=1)C=CC=C2)))=O * inchi...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5913 PWY-5913] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1118 TAX-11...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5913 PWY-5913] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1118 TAX-1118] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1217 TAX-1217] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] |
* common name: | * common name: | ||
− | ** | + | ** partial TCA cycle (obligate autotrophs) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** TCA cycle VI (obligate autotrophs) |
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''10''' reactions found over '''11''' reactions in the full pathway |
− | * [[RXN- | + | * [[ACONITATEDEHYDR-RXN]] |
− | + | ** 2 associated gene(s): | |
− | == Reaction(s) | + | *** [[Ec-16_001000]] |
+ | *** [[Ec-12_000170]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[ACONITATEHYDR-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Ec-16_001000]] | ||
+ | *** [[Ec-12_000170]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[ASPAMINOTRANS-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Ec-03_003270]] | ||
+ | *** [[Ec-01_007480]] | ||
+ | *** [[Ec-23_003500]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[CITSYN-RXN]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[FUMHYDR-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Ec-25_001360]] | ||
+ | *** [[Ec-23_003460]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[GLUTDEHYD-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Ec-06_008240]] | ||
+ | *** [[Ec-12_008040]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[ISOCITDEH-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-11_003080]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[MALATE-DEH-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Ec-10_006200]] | ||
+ | *** [[Ec-02_003100]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[PEPCARBOX-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-28_003470]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[SUCCCOASYN-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Ec-10_000030]] | ||
+ | *** [[Ec-02_001020]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14970 RXN-14970] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-1118}} | |
− | + | {{#set: taxonomic range=TAX-1217}} | |
− | + | {{#set: taxonomic range=TAX-1224}} | |
− | + | {{#set: common name=partial TCA cycle (obligate autotrophs)}} | |
− | + | {{#set: common name=TCA cycle VI (obligate autotrophs)}} | |
− | + | {{#set: reaction found=10}} | |
− | + | {{#set: total reaction=11}} | |
− | + | {{#set: completion rate=91.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:00, 21 March 2018
Pathway PWY-5913
- taxonomic range:
- common name:
- partial TCA cycle (obligate autotrophs)
- Synonym(s):
- TCA cycle VI (obligate autotrophs)
Reaction(s) found
10 reactions found over 11 reactions in the full pathway
- ACONITATEDEHYDR-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- ACONITATEHYDR-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- ASPAMINOTRANS-RXN
- 3 associated gene(s):
- 2 reconstruction source(s) associated:
- CITSYN-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- FUMHYDR-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- GLUTDEHYD-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- ISOCITDEH-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- MALATE-DEH-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- PEPCARBOX-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- SUCCCOASYN-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated: