Difference between revisions of "PWY-6654"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-D-GALACTOSE ALPHA-D-GALACTOSE] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: **...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6654 PWY-6654] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6654 PWY-6654] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** phosphopantothenate biosynthesis III |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''2''' reactions found over '''4''' reactions in the full pathway | |
| − | * [[ | + | * [[2-DEHYDROPANTOATE-REDUCT-RXN]] |
| − | * [[RXN- | + | ** 1 associated gene(s): |
| − | == Reaction(s) | + | *** [[Ec-14_006010]] |
| − | * [ | + | ** 1 reconstruction source(s) associated: |
| − | * [ | + | *** [[annotation-esiliculosus_genome]] |
| + | * [[RXN-15635]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Ec-01_001700]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11781 RXN-11781] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11782 RXN-11782] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2157}} | |
| − | + | {{#set: common name=phosphopantothenate biosynthesis III}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=4}} | |
| − | + | {{#set: completion rate=50.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 19:00, 21 March 2018
Pathway PWY-6654
- taxonomic range:
- common name:
- phosphopantothenate biosynthesis III
- Synonym(s):
Reaction(s) found
2 reactions found over 4 reactions in the full pathway
- 2-DEHYDROPANTOATE-REDUCT-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-15635
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
