Difference between revisions of "PWY-5132"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-METHYLXANTHINE 7-METHYLXANTHINE] == * smiles: ** CN1(C=NC2(NC(=O)NC(=O)C1=2)) * inchi key: **...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5132 PWY-5132] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3481 TAX-34...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5132 PWY-5132] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3481 TAX-3481] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** humulone biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** Bitter α-acid (humulone) biosynthesis |
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''2''' reactions found over '''4''' reactions in the full pathway |
| − | + | * [[RXN-7810]] | |
| − | == Reaction(s) | + | ** 1 associated gene(s): |
| + | *** [[Ec-07_006170]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[RXN-7811]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Ec-07_006170]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.156-RXN 2.3.1.156-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-7807 RXN-7807] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-3481}} | |
| − | + | {{#set: common name=humulone biosynthesis}} | |
| − | + | {{#set: common name=Bitter α-acid (humulone) biosynthesis}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=4}} | |
| − | + | {{#set: completion rate=50.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:00, 21 March 2018
Pathway PWY-5132
- taxonomic range:
- common name:
- humulone biosynthesis
- Synonym(s):
- Bitter α-acid (humulone) biosynthesis
Reaction(s) found
2 reactions found over 4 reactions in the full pathway
- RXN-7810
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-7811
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
