Difference between revisions of "Ec-01 004320"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] == * smiles: ** C(CC[N+]CCCCC[N+])[N+] * inchi key: ** InChIKey=QZBYOYPROV...")
(Created page with "Category:Gene == Gene Ec-01_004320 == * Synonym(s): ** Esi_0145_0068 ** Esi0145_0068 == Reactions associated == * Reaction: ATPASE-RXN ** Source: orthology-aragem...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] ==
+
== Gene Ec-01_004320 ==
* smiles:
+
** C(CC[N+]CCCCC[N+])[N+]
+
* inchi key:
+
** InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q
+
* common name:
+
** aminopropylcadaverine
+
* molecular weight:
+
** 162.298   
+
 
* Synonym(s):
 
* Synonym(s):
** N-3-aminopropyl-1,5-diaminopentane
+
** Esi_0145_0068
 +
** Esi0145_0068
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ATPASE-RXN]]
* [[RXN0-5217]]
+
** Source: [[orthology-aragem]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=Esi_0145_0068|Esi0145_0068}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246266 25246266]
+
{{#set: reaction associated=ATPASE-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64858 64858]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C16565 C16565]
+
* HMDB : HMDB12189
+
{{#set: smiles=C(CC[N+]CCCCC[N+])[N+]}}
+
{{#set: inchi key=InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q}}
+
{{#set: common name=aminopropylcadaverine}}
+
{{#set: molecular weight=162.298    }}
+
{{#set: common name=N-3-aminopropyl-1,5-diaminopentane}}
+
{{#set: produced by=RXN0-5217}}
+

Latest revision as of 19:00, 21 March 2018

Gene Ec-01_004320

  • Synonym(s):
    • Esi_0145_0068
    • Esi0145_0068

Reactions associated

Pathways associated

External links