Difference between revisions of "PWY-6282"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-786 CPD-786] == * smiles: ** C(CCC=CC(C([O-])=O)=O)([O-])=O * inchi key: ** InChIKey=HYVSZV...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6282 PWY-6282] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-786 CPD-786] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6282 PWY-6282] ==
−
* smiles:
+
* taxonomic range:
−
** C(CCC=CC(C([O-])=O)=O)([O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=HYVSZVZMTYIHKF-IWQZZHSRSA-L
+
 
* common name:
 
* common name:
−
** (4Z)-2-oxohept-4-enedioate
+
** palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate)
−
* molecular weight:
+
−
** 170.121   
+
 
* Synonym(s):
 
* Synonym(s):
−
** OHED
+
** palmitoleic acid biosynthesis I
−
** 2-oxo-hept-3-ene-1,7-dioate
+
** palmitoleate biosynthesis (anaerobic)
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''9''' reactions found over '''9''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[RXN-10654]]
−
* [[RXN1K-87]]
+
** 4 associated gene(s):
 +
*** [[Ec-27_003480]]
 +
*** [[Ec-12_000640]]
 +
*** [[Ec-12_000650]]
 +
*** [[Ec-27_002090]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-10655]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_007100]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-10656]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-10657]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_002470]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-10658]]
 +
** 4 associated gene(s):
 +
*** [[Ec-12_000640]]
 +
*** [[Ec-12_000650]]
 +
*** [[Ec-27_002090]]
 +
*** [[Ec-27_003480]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-10659]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_007100]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-10660]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-10661]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_002470]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-9550]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ECOCYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460000 5460000]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6282 PWY-6282]
−
* CHEMSPIDER:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://www.chemspider.com/Chemical-Structure.4573699.html 4573699]
+
{{#set: common name=palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate)}}
−
* CHEBI:
+
{{#set: common name=palmitoleic acid biosynthesis I|palmitoleate biosynthesis (anaerobic)}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17205 17205]
+
{{#set: reaction found=9}}
−
* LIGAND-CPD:
+
{{#set: total reaction=9}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03063 C03063]
+
{{#set: completion rate=100.0}}
−
{{#set: smiles=C(CCC=CC(C([O-])=O)=O)([O-])=O}}
+
−
{{#set: inchi key=InChIKey=HYVSZVZMTYIHKF-IWQZZHSRSA-L}}
+
−
{{#set: common name=(4Z)-2-oxohept-4-enedioate}}
+
−
{{#set: molecular weight=170.121    }}
+
−
{{#set: common name=OHED|2-oxo-hept-3-ene-1,7-dioate}}
+
−
{{#set: reversible reaction associated=RXN1K-87}}
+

Latest revision as of 19:01, 21 March 2018

Pathway PWY-6282

  • taxonomic range:
  • common name:
    • palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate)
  • Synonym(s):
    • palmitoleic acid biosynthesis I
    • palmitoleate biosynthesis (anaerobic)

Reaction(s) found

9 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-6282&oldid=23875"