Difference between revisions of "PWY-4081"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1301 CPD-1301] == * smiles: ** C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4081 PWY-4081] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1301 CPD-1301] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4081 PWY-4081] ==
−
* smiles:
+
* taxonomic range:
−
** C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
** InChIKey=RXWVHRYZTWZATH-XSLAGTTESA-J
+
 
* common name:
 
* common name:
−
** tetrahydropteroyl tri-L-glutamate
+
** glutathione-peroxide redox reactions
−
* molecular weight:
+
−
** 699.633   
+
 
* Synonym(s):
 
* Synonym(s):
−
** H4PteGlu3
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''3''' reactions in the full pathway
−
* [[RXN-12730]]
+
* [[1.11.1.12-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
−
* [[HOMOCYSMET-RXN]]
+
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[GLUTATHIONE-PEROXIDASE-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Ec-00_006580]]
 +
*** [[Ec-08_001740]]
 +
*** [[Ec-14_004400]]
 +
*** [[Ec-05_005450]]
 +
*** [[Ec-09_004680]]
 +
*** [[Ec-05_005460]]
 +
*** [[Ec-11_004010]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-24_001330]]
 +
*** [[Ec-00_010830]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791999 49791999]
+
{{#set: taxonomic range=TAX-2759}}
−
* CHEMSPIDER:
+
{{#set: common name=glutathione-peroxide redox reactions}}
−
** [http://www.chemspider.com/Chemical-Structure.17625690.html 17625690]
+
{{#set: reaction found=3}}
−
* CHEBI:
+
{{#set: total reaction=3}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58140 58140]
+
{{#set: completion rate=100.0}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C04144 C04144]
+
−
* HMDB : HMDB12290
+
−
{{#set: smiles=C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3)}}
+
−
{{#set: inchi key=InChIKey=RXWVHRYZTWZATH-XSLAGTTESA-J}}
+
−
{{#set: common name=tetrahydropteroyl tri-L-glutamate}}
+
−
{{#set: molecular weight=699.633    }}
+
−
{{#set: common name=H4PteGlu3}}
+
−
{{#set: produced by=RXN-12730}}
+
−
{{#set: reversible reaction associated=HOMOCYSMET-RXN}}
+

Latest revision as of 20:01, 21 March 2018

Pathway PWY-4081

  • taxonomic range:
  • common name:
    • glutathione-peroxide redox reactions
  • Synonym(s):

Reaction(s) found

3 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-4081&oldid=23892"