Difference between revisions of "CPD-7139"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CMP CMP] == * smiles: ** C(C2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))OP([O-])([O-])=O * inchi key: *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5))) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N |
* common name: | * common name: | ||
| − | ** | + | ** delphinidin 3,5-di-O-β-D-glucoside |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 626.524 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** delphinidin-3,5-diglucoside |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-8228]] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201902 25201902] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77838 77838] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles=C( | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16312 C16312] |
| − | {{#set: inchi key=InChIKey= | + | * HMDB : HMDB30693 |
| − | {{#set: common name= | + | {{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=delphinidin 3,5-di-O-β-D-glucoside}} |
| − | + | {{#set: molecular weight=626.524 }} | |
| − | {{#set: produced by=RXN- | + | {{#set: common name=delphinidin-3,5-diglucoside}} |
| − | + | {{#set: produced by=RXN-8228}} | |
Latest revision as of 19:01, 21 March 2018
Contents
Metabolite CPD-7139
- smiles:
- C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))
- inchi key:
- InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N
- common name:
- delphinidin 3,5-di-O-β-D-glucoside
- molecular weight:
- 626.524
- Synonym(s):
- delphinidin-3,5-diglucoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))" cannot be used as a page name in this wiki.
