Difference between revisions of "Ec-10 003030"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] == * smiles: ** CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
 
(Created page with "Category:Gene == Gene Ec-10_003030 == * left end position: ** 3099088 * transcription direction: ** POSITIVE * right end position: ** 3103366 * centisome position: ** 47.6...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] ==
+
== Gene Ec-10_003030 ==
−
* smiles:
+
* left end position:
−
** CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 3099088
−
* inchi key:
+
* transcription direction:
−
** InChIKey=HQANBZHVWIDNQZ-GMHMEAMDSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 3-oxododecanoyl-CoA
+
** 3103366
−
* molecular weight:
+
* centisome position:
−
** 959.791    
+
** 47.67105    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxolauroyl-CoA
+
** Esi_0174_0069
 +
** Esi0174_0069
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[HOLOCYTOCHROME-C-SYNTHASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-14274]]
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: left end position=3099088}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05263 C05263]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=3103366}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62615 62615]
+
{{#set: centisome position=47.67105   }}
−
* BIGG : 45453
+
{{#set: common name=Esi_0174_0069|Esi0174_0069}}
−
* PUBCHEM:
+
{{#set: reaction associated=HOLOCYTOCHROME-C-SYNTHASE-RXN}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173506 46173506]
+
−
* HMDB : HMDB03937
+
−
{{#set: smiles=CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=HQANBZHVWIDNQZ-GMHMEAMDSA-J}}
+
−
{{#set: common name=3-oxododecanoyl-CoA}}
+
−
{{#set: molecular weight=959.791   }}
+
−
{{#set: common name=3-oxolauroyl-CoA}}
+
−
{{#set: consumed or produced by=RXN-14274}}
+

Latest revision as of 20:06, 21 March 2018

Gene Ec-10_003030

  • left end position:
    • 3099088
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3103366
  • centisome position:
    • 47.67105
  • Synonym(s):
    • Esi_0174_0069
    • Esi0174_0069

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-10_003030&oldid=24522"