Difference between revisions of "RXN-7163"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONATE L-GULONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey=R...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7163 RXN-7163] == * direction: ** LEFT-TO-RIGHT * common name: ** Inositol polyphosphate kinase...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7163 RXN-7163] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Inositol polyphosphate kinase |
− | * | + | ** inositol pentakisphosphate 2-kinase |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/2.7.1.158 EC-2.7.1.158] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[ATP]][c] '''+''' 1 [[CPD-1107]][c] '''=>''' 1 [[MI-HEXAKISPHOSPHATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c] |
− | = | + | * With common name(s): |
+ | ** 1 ATP[c] '''+''' 1 D-myo-inositol 1,3,4,5,6-pentakisphosphate[c] '''=>''' 1 phytate[c] '''+''' 1 H+[c] '''+''' 1 ADP[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-16_003350]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-18_000620]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | * [[PWY-6362]], 1D-myo-inositol hexakisphosphate biosynthesis II (mammalian): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6362 PWY-6362] | ||
+ | ** '''4''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY-6361]], 1D-myo-inositol hexakisphosphate biosynthesis I (from Ins(1,4,5)P3): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6361 PWY-6361] | ||
+ | ** '''2''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY-4661]], 1D-myo-inositol hexakisphosphate biosynthesis III (Spirodela polyrrhiza): [http://metacyc.org/META/NEW-IMAGE?object=PWY-4661 PWY-4661] | ||
+ | ** '''3''' reactions found over '''7''' reactions in the full pathway | ||
+ | * [[PWY-6369]], inositol pyrophosphates biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6369 PWY-6369] | ||
+ | ** '''1''' reactions found over '''9''' reactions in the full pathway | ||
+ | * [[PWY-6554]], 1D-myo-inositol hexakisphosphate biosynthesis V (from Ins(1,3,4)P3): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6554 PWY-6554] | ||
+ | ** '''4''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY-6372]], 1D-myo-inositol hexakisphosphate biosynthesis IV (Dictyostelium): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6372 PWY-6372] | ||
+ | ** '''3''' reactions found over '''7''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20313 20313] | |
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R05202 R05202] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | ** [http://www.ebi.ac.uk/ | + | {{#set: common name=Inositol polyphosphate kinase}} |
− | + | {{#set: common name=inositol pentakisphosphate 2-kinase}} | |
− | * LIGAND- | + | {{#set: ec number=EC-2.7.1.158}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: gene associated=Ec-16_003350|Ec-18_000620}} |
− | {{#set: | + | {{#set: in pathway=PWY-6362|PWY-6361|PWY-4661|PWY-6369|PWY-6554|PWY-6372}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:01, 21 March 2018
Contents
Reaction RXN-7163
- direction:
- LEFT-TO-RIGHT
- common name:
- Inositol polyphosphate kinase
- inositol pentakisphosphate 2-kinase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ATP[c] + 1 CPD-1107[c] => 1 MI-HEXAKISPHOSPHATE[c] + 1 PROTON[c] + 1 ADP[c]
- With common name(s):
- 1 ATP[c] + 1 D-myo-inositol 1,3,4,5,6-pentakisphosphate[c] => 1 phytate[c] + 1 H+[c] + 1 ADP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-16_003350
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-18_000620
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
- PWY-6362, 1D-myo-inositol hexakisphosphate biosynthesis II (mammalian): PWY-6362
- 4 reactions found over 5 reactions in the full pathway
- PWY-6361, 1D-myo-inositol hexakisphosphate biosynthesis I (from Ins(1,4,5)P3): PWY-6361
- 2 reactions found over 5 reactions in the full pathway
- PWY-4661, 1D-myo-inositol hexakisphosphate biosynthesis III (Spirodela polyrrhiza): PWY-4661
- 3 reactions found over 7 reactions in the full pathway
- PWY-6369, inositol pyrophosphates biosynthesis: PWY-6369
- 1 reactions found over 9 reactions in the full pathway
- PWY-6554, 1D-myo-inositol hexakisphosphate biosynthesis V (from Ins(1,3,4)P3): PWY-6554
- 4 reactions found over 5 reactions in the full pathway
- PWY-6372, 1D-myo-inositol hexakisphosphate biosynthesis IV (Dictyostelium): PWY-6372
- 3 reactions found over 7 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links