Difference between revisions of "Ec-08 005990"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAMINE DOPAMINE] == * smiles: ** C(CC1(C=C(C(=CC=1)O)O))[N+] * inchi key: ** InChIKey=VYFYYTL...") |
(Created page with "Category:Gene == Gene Ec-08_005990 == * left end position: ** 5754796 * transcription direction: ** NEGATIVE * right end position: ** 5765157 * centisome position: ** 85.9...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-08_005990 == |
− | * | + | * left end position: |
− | ** | + | ** 5754796 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 5765157 |
− | * | + | * centisome position: |
− | ** | + | ** 85.93010 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0005_0168 |
− | ** | + | ** Esi0005_0168 |
− | ** | + | ** MAPK |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[PROTEIN-KINASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: go-term |
− | == | + | * Reaction: [[RXN-8443]] |
− | + | ** Source: [[orthology-aragem]] | |
+ | == Pathways associated == | ||
+ | * [[PWY-5381]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5754796}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=5765157}} | |
− | + | {{#set: centisome position=85.93010 }} | |
− | + | {{#set: common name=Esi_0005_0168|Esi0005_0168|MAPK}} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN|RXN-8443}} | |
− | + | {{#set: pathway associated=PWY-5381}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:02, 21 March 2018
Gene Ec-08_005990
- left end position:
- 5754796
- transcription direction:
- NEGATIVE
- right end position:
- 5765157
- centisome position:
- 85.93010
- Synonym(s):
- Esi_0005_0168
- Esi0005_0168
- MAPK
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-8443
- Source: orthology-aragem