Difference between revisions of "GLYSYN-ALA-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLYSYN-ALA-PWY GLYSYN-ALA-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLYSYN-ALA-PWY GLYSYN-ALA-PWY] ==
* smiles:
+
* taxonomic range:
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
** InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 
* common name:
 
* common name:
** ergosta-5,7,24(28)-trien-3β-ol
+
** glycine biosynthesis III
* molecular weight:
+
** 396.655   
+
 
* Synonym(s):
 
* Synonym(s):
** 5,7,24(28)-ergostatrienol
 
** 5-dehydro episterol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-707]]
+
'''1''' reactions found over '''1''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[ALANINE--GLYOXYLATE-AMINOTRANSFERASE-RXN]]
* [[RXN3O-218]]
+
** 2 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-21_003730]]
 +
*** [[Ec-14_006580]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.genome.jp/dbget-bin/www_bget?C15780 C15780]
+
{{#set: taxonomic range=TAX-2157}}
* HMDB : HMDB06848
+
{{#set: taxonomic range=TAX-2759}}
* CHEBI:
+
{{#set: common name=glycine biosynthesis III}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=52972 52972]
+
{{#set: reaction found=1}}
* PUBCHEM:
+
{{#set: total reaction=1}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10894570 10894570]
+
{{#set: completion rate=100.0}}
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N}}
+
{{#set: common name=ergosta-5,7,24(28)-trien-3β-ol}}
+
{{#set: molecular weight=396.655    }}
+
{{#set: common name=5,7,24(28)-ergostatrienol|5-dehydro episterol}}
+
{{#set: consumed by=RXN-707}}
+
{{#set: produced by=RXN3O-218}}
+

Latest revision as of 20:02, 21 March 2018

Pathway GLYSYN-ALA-PWY

Reaction(s) found

1 reactions found over 1 reactions in the full pathway

Reaction(s) not found

External links