Difference between revisions of "CPD-15360"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14053 CPD-14053] == * smiles: ** CC(O)C(O)[CH]1(CNC2(N=C(N)NC(C(N1)=2)=O)) * common name: *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15360 CPD-15360] == * smiles: ** CC(C)=CCNC2(C1(N=CN(C=1N=C(S)N=2)C3(OC(COP(O[a tRNA])(=O)[...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15360 CPD-15360] == |
* smiles: | * smiles: | ||
| − | ** CC( | + | ** CC(C)=CCNC2(C1(N=CN(C=1N=C(S)N=2)C3(OC(COP(O[a tRNA])(=O)[O-])C(OP([O-])(=O)O[a tRNA])C(O)3))) |
* common name: | * common name: | ||
| − | ** | + | ** 2-thio-N6-dimethylallyladenosine37 in tRNA |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** ( | + | ** tRNA-(2-thio-N6-dimethylallyladenosine37) |
| + | ** a tRNA containing 2-thio-N6-dimethylallyladenosine37 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-14481]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-14480]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74416 74416] |
| − | + | {{#set: smiles=CC(C)=CCNC2(C1(N=CN(C=1N=C(S)N=2)C3(OC(COP(O[a tRNA])(=O)[O-])C(OP([O-])(=O)O[a tRNA])C(O)3)))}} | |
| − | + | {{#set: common name=2-thio-N6-dimethylallyladenosine37 in tRNA}} | |
| − | {{#set: smiles=CC( | + | {{#set: common name=tRNA-(2-thio-N6-dimethylallyladenosine37)|a tRNA containing 2-thio-N6-dimethylallyladenosine37}} |
| − | {{#set: common name= | + | {{#set: consumed by=RXN-14481}} |
| − | + | {{#set: reversible reaction associated=RXN-14480}} | |
| − | + | ||
| − | {{#set: common name=( | + | |
| − | {{#set: consumed by= | + | |
| − | {{#set: | + | |
Latest revision as of 19:02, 21 March 2018
Contents
Metabolite CPD-15360
- smiles:
- CC(C)=CCNC2(C1(N=CN(C=1N=C(S)N=2)C3(OC(COP(O[a tRNA])(=O)[O-])C(OP([O-])(=O)O[a tRNA])C(O)3)))
- common name:
- 2-thio-N6-dimethylallyladenosine37 in tRNA
- Synonym(s):
- tRNA-(2-thio-N6-dimethylallyladenosine37)
- a tRNA containing 2-thio-N6-dimethylallyladenosine37
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CHEBI:
"CC(C)=CCNC2(C1(N=CN(C=1N=C(S)N=2)C3(OC(COP(O[a tRNA])(=O)[O-])C(OP([O-])(=O)O[a tRNA])C(O)3)))" cannot be used as a page name in this wiki.
