Difference between revisions of "CPD-694"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-01_000430 == * left end position: ** 321846 * transcription direction: ** POSITIVE * right end position: ** 327714 * centisome position: ** 3.1190...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-694 CPD-694] == * smiles: ** CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-]...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-01_000430 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-694 CPD-694] ==
−
* left end position:
+
* smiles:
−
** 321846
+
** CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-])=O)C(CC(=O)N)(C)2)C(C(CCC(=O)[O-])C=3C=C5(C(C)(C)C(CCC(=O)[O-])C(=[N+]45)6))(CC(=O)N)C))N78))C))CC(=O)[O-])(C)CCC(=O)[O-]))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=NKLHEMWEQJCPPF-OKJGWHJPSA-H
−
* right end position:
+
* common name:
−
** 327714
+
** cob(I)yrinate a,c-diamide
−
* centisome position:
+
* molecular weight:
−
** 3.1190152    
+
** 931.9    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0486_0007
+
** cob(I)yrinic acid a,c-diamide
−
** Esi0486_0007
+
** Cob(I)yrinate diamide
−
** GTR
+
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[GLUTRNAREDUCT-RXN]]
+
* [[R344-RXN]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
−
* [[PWY-5188]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=321846}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266689 45266689]
−
{{#set: right end position=327714}}
+
* CHEBI:
−
{{#set: centisome position=3.1190152   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58575 58575]
−
{{#set: common name=Esi_0486_0007|Esi0486_0007|GTR}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=GLUTRNAREDUCT-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C06505 C06505]
−
{{#set: pathway associated=PWY-5188}}
+
* HMDB : HMDB06904
 +
{{#set: smiles=CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-])=O)C(CC(=O)N)(C)2)C(C(CCC(=O)[O-])C=3C=C5(C(C)(C)C(CCC(=O)[O-])C(=[N+]45)6))(CC(=O)N)C))N78))C))CC(=O)[O-])(C)CCC(=O)[O-]))}}
 +
{{#set: inchi key=InChIKey=NKLHEMWEQJCPPF-OKJGWHJPSA-H}}
 +
{{#set: common name=cob(I)yrinate a,c-diamide}}
 +
{{#set: molecular weight=931.9   }}
 +
{{#set: common name=cob(I)yrinic acid a,c-diamide|Cob(I)yrinate diamide}}
 +
{{#set: consumed by=R344-RXN}}

Latest revision as of 19:03, 21 March 2018

Metabolite CPD-694

  • smiles:
    • CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-])=O)C(CC(=O)N)(C)2)C(C(CCC(=O)[O-])C=3C=C5(C(C)(C)C(CCC(=O)[O-])C(=[N+]45)6))(CC(=O)N)C))N78))C))CC(=O)[O-])(C)CCC(=O)[O-]))
  • inchi key:
    • InChIKey=NKLHEMWEQJCPPF-OKJGWHJPSA-H
  • common name:
    • cob(I)yrinate a,c-diamide
  • molecular weight:
    • 931.9
  • Synonym(s):
    • cob(I)yrinic acid a,c-diamide
    • Cob(I)yrinate diamide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-])=O)C(CC(=O)N)(C)2)C(C(CCC(=O)[O-])C=3C=C5(C(C)(C)C(CCC(=O)[O-])C(=[N+]45)6))(CC(=O)N)C))N78))C))CC(=O)[O-])(C)CCC(=O)[O-]))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-694&oldid=24133"