Difference between revisions of "Branched-chain-2-keto-acid-deH-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] == * smiles: ** C(C([O-])=O)NC(C(CS)[N+])=O * inchi key: ** InChIKey=ZUKPVRWZD...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Branched-chain-2-keto-acid-deH-P Branched-chain-2-keto-acid-deH-P] == * common name: ** a phosp...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Branched-chain-2-keto-acid-deH-P Branched-chain-2-keto-acid-deH-P] ==
−
* smiles:
+
−
** C(C([O-])=O)NC(C(CS)[N+])=O
+
−
* inchi key:
+
−
** InChIKey=ZUKPVRWZDMRIEO-VKHMYHEASA-N
+
 
* common name:
 
* common name:
−
** L-cysteinyl-glycine
+
** a phosphorylated branched-chain 2-keto acid dehydrogenase
−
* molecular weight:
+
−
** 178.206   
+
 
* Synonym(s):
 
* Synonym(s):
−
** Cys-Gly
+
** [3-methyl-2-oxobutanoate dehydrogenase (acetyl-transferring)] phosphate
−
** cysteinylglycine
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-6622]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-6601]]
 
−
* [[RXN-9157]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[2.7.11.4-RXN]]
 
== External links  ==
 
== External links  ==
−
* BIGG : 1445980
+
{{#set: common name=a phosphorylated branched-chain 2-keto acid dehydrogenase}}
−
* PUBCHEM:
+
{{#set: common name=[3-methyl-2-oxobutanoate dehydrogenase (acetyl-transferring)] phosphate}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098621 7098621]
+
{{#set: reversible reaction associated=2.7.11.4-RXN}}
−
* HMDB : HMDB00078
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01419 C01419]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61694 61694]
+
−
* METABOLIGHTS : MTBLC4047
+
−
{{#set: smiles=C(C([O-])=O)NC(C(CS)[N+])=O}}
+
−
{{#set: inchi key=InChIKey=ZUKPVRWZDMRIEO-VKHMYHEASA-N}}
+
−
{{#set: common name=L-cysteinyl-glycine}}
+
−
{{#set: molecular weight=178.206    }}
+
−
{{#set: common name=Cys-Gly|cysteinylglycine}}
+
−
{{#set: consumed by=RXN-6622}}
+
−
{{#set: produced by=RXN-6601|RXN-9157}}
+

Latest revision as of 20:03, 21 March 2018

Metabolite Branched-chain-2-keto-acid-deH-P

  • common name:
    • a phosphorylated branched-chain 2-keto acid dehydrogenase
  • Synonym(s):
    • [3-methyl-2-oxobutanoate dehydrogenase (acetyl-transferring)] phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"3-methyl-2-oxobutanoate dehydrogenase (acetyl-transferring)] phosphate" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Branched-chain-2-keto-acid-deH-P&oldid=24139"