Difference between revisions of "Protein-L-serines"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] == * smiles: ** C(=CC1(=CC=C(O)C=C1))CO * inchi key: ** InCh...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-serines Protein-L-serines] == * common name: ** a [protein]-L-serine * Synonym(s): =...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-serines Protein-L-serines] ==
* smiles:
+
** C(=CC1(=CC=C(O)C=C1))CO
+
* inchi key:
+
** InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N
+
 
* common name:
 
* common name:
** 4-coumaryl alcohol
+
** a [protein]-L-serine
* molecular weight:
+
** 150.177   
+
 
* Synonym(s):
 
* Synonym(s):
** p-coumaryl alcohol
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1102]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[2.7.12.1-RXN]]
 +
* [[5.1.1.16-RXN]]
 +
* [[2.4.1.221-RXN]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a [protein]-L-serine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280535 5280535]
+
{{#set: reversible reaction associated=2.7.12.1-RXN|5.1.1.16-RXN|2.4.1.221-RXN}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.4444166.html 4444166]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28386 28386]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C02646 C02646]
+
* HMDB : HMDB03654
+
{{#set: smiles=C(=CC1(=CC=C(O)C=C1))CO}}
+
{{#set: inchi key=InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N}}
+
{{#set: common name=4-coumaryl alcohol}}
+
{{#set: molecular weight=150.177    }}
+
{{#set: common name=p-coumaryl alcohol}}
+
{{#set: produced by=RXN-1102}}
+

Latest revision as of 19:03, 21 March 2018

Metabolite Protein-L-serines

  • common name:
    • a [protein]-L-serine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [protein]-L-serine" cannot be used as a page name in this wiki.