Difference between revisions of "CPD-1086"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7908 RXN-7908] == * direction: ** LEFT-TO-RIGHT * common name: ** 4-alpha-hydroxytetrahydrobiop...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1086 CPD-1086] == * smiles: ** C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-] * in...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7908 RXN-7908] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1086 CPD-1086] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-]
 +
* inchi key:
 +
** InChIKey=RQRINYISXYAZKL-RPDRRWSUSA-L
 
* common name:
 
* common name:
** 4-alpha-hydroxytetrahydrobiopterin dehydratase
+
** 5-amino-6-(5-phospho-D-ribitylamino)uracil
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/4.2.1.96 EC-4.2.1.96]
+
** 354.213   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5-amino-6-(5'-phosphoribitylamino)uracil
 +
** 5-amino-6-(5-phosphoribitylamino)uracil
 +
** 5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione 5'-phosphate
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[CPD-5881]][c] '''=>''' 1 [[BIOPTERIN]][c] '''+''' 1 [[WATER]][c]
+
* [[RIBOFLAVINSYNREDUC-RXN]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 4α-hydroxy-tetrahydrobiopterin[c] '''=>''' 1 7,8-dihydrobiopterin[c] '''+''' 1 H2O[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Ec-12_001420]]
+
** ESILICULOSUS_GENOME
+
***GO-TERM
+
== Pathways  ==
+
* [[PHENYLALANINE-DEG1-PWY]], L-phenylalanine degradation I (aerobic): [http://metacyc.org/META/NEW-IMAGE?object=PHENYLALANINE-DEG1-PWY PHENYLALANINE-DEG1-PWY]
+
** '''1''' reactions found over '''3''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
* LIGAND-CPD:
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11920 11920]
+
** [http://www.genome.jp/dbget-bin/www_bget?C04454 C04454]
* LIGAND-RXN:
+
* CHEBI:
** [http://www.genome.jp/dbget-bin/www_bget?R04734 R04734]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58421 58421]
{{#set: direction=LEFT-TO-RIGHT}}
+
* BIGG : 43851
{{#set: common name=4-alpha-hydroxytetrahydrobiopterin dehydratase}}
+
* PUBCHEM:
{{#set: ec number=EC-4.2.1.96}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266638 45266638]
{{#set: gene associated=Ec-12_001420}}
+
* HMDB : HMDB03841
{{#set: in pathway=PHENYLALANINE-DEG1-PWY}}
+
{{#set: smiles=C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-]}}
{{#set: reconstruction category=annotation}}
+
{{#set: inchi key=InChIKey=RQRINYISXYAZKL-RPDRRWSUSA-L}}
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: common name=5-amino-6-(5-phospho-D-ribitylamino)uracil}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=354.213    }}
 +
{{#set: common name=5-amino-6-(5'-phosphoribitylamino)uracil|5-amino-6-(5-phosphoribitylamino)uracil|5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione 5'-phosphate}}
 +
{{#set: produced by=RIBOFLAVINSYNREDUC-RXN}}

Latest revision as of 19:03, 21 March 2018

Metabolite CPD-1086

  • smiles:
    • C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-]
  • inchi key:
    • InChIKey=RQRINYISXYAZKL-RPDRRWSUSA-L
  • common name:
    • 5-amino-6-(5-phospho-D-ribitylamino)uracil
  • molecular weight:
    • 354.213
  • Synonym(s):
    • 5-amino-6-(5'-phosphoribitylamino)uracil
    • 5-amino-6-(5-phosphoribitylamino)uracil
    • 5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione 5'-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-" cannot be used as a page name in this wiki.