|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4.4.1.14-RXN 4.4.1.14-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** C(=CC1(=CC=C(O)C=C1))CO |
| + | * inchi key: |
| + | ** InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N |
| * common name: | | * common name: |
− | ** 1-aminocyclopropane-1-carboxylate synthase | + | ** 4-coumaryl alcohol |
− | * ec number: | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/4.4.1.14 EC-4.4.1.14] | + | ** 150.177 |
| * Synonym(s): | | * Synonym(s): |
| + | ** p-coumaryl alcohol |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[5-METHYLTHIOADENOSINE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-68]][c]
| + | * [[RXN-1102]] |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 S-adenosyl-L-methionine[c] '''=>''' 1 S-methyl-5'-thioadenosine[c] '''+''' 1 H+[c] '''+''' 1 1-aminocyclopropane-1-carboxylate[c]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Ec-04_003460]] | + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | == Pathways == | + | |
− | * [[ETHYL-PWY]], ethylene biosynthesis I (plants): [http://metacyc.org/META/NEW-IMAGE?object=ETHYL-PWY ETHYL-PWY]
| + | |
− | ** '''2''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY-7270]], L-methionine salvage cycle II (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7270 PWY-7270]
| + | |
− | ** '''3''' reactions found over '''7''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * Category: [[orthology]]
| + | |
− | ** Source: [[orthology-aragem]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21747 21747] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280535 5280535] |
− | * LIGAND-RXN: | + | * CHEMSPIDER: |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00179 R00179] | + | ** [http://www.chemspider.com/Chemical-Structure.4444166.html 4444166] |
− | * UNIPROT:
| + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/P23279 P23279]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28386 28386] |
− | ** [http://www.uniprot.org/uniprot/Q06402 Q06402] | + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/Q07215 Q07215] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02646 C02646] |
− | ** [http://www.uniprot.org/uniprot/Q42881 Q42881]
| + | * HMDB : HMDB03654 |
− | ** [http://www.uniprot.org/uniprot/Q00379 Q00379]
| + | {{#set: smiles=C(=CC1(=CC=C(O)C=C1))CO}} |
− | ** [http://www.uniprot.org/uniprot/Q06429 Q06429] | + | {{#set: inchi key=InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N}} |
− | ** [http://www.uniprot.org/uniprot/Q9SB01 Q9SB01] | + | {{#set: common name=4-coumaryl alcohol}} |
− | ** [http://www.uniprot.org/uniprot/O24062 O24062] | + | {{#set: molecular weight=150.177 }} |
− | ** [http://www.uniprot.org/uniprot/Q9SB94 Q9SB94]
| + | {{#set: common name=p-coumaryl alcohol}} |
− | ** [http://www.uniprot.org/uniprot/Q9FUC3 Q9FUC3]
| + | {{#set: produced by=RXN-1102}} |
− | ** [http://www.uniprot.org/uniprot/Q94GA4 Q94GA4]
| + | |
− | ** [http://www.uniprot.org/uniprot/O24217 O24217]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9S9C5 Q9S9C5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43309 Q43309]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23599 P23599]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q00257 Q00257]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43679 Q43679]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q07223 Q07223]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M286 Q7M286]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27486 P27486]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18485 P18485]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29535 P29535]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41693 Q41693]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41694 Q41694]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31531 P31531]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43858 Q43858]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43753 Q43753]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43813 Q43813]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43059 Q43059]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43167 Q43167]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43747 Q43747]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43074 Q43074]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42655 Q42655]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42718 Q42718]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43755 Q43755]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43756 Q43756]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43165 Q43165]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22464 O22464]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43166 Q43166]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43168 Q43168]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q37001 Q37001]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43201 Q43201]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43204 Q43204]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49904 O49904]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42984 Q42984]
| + | |
− | ** [http://www.uniprot.org/uniprot/O24220 O24220]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q07262 Q07262]
| + | |
− | ** [http://www.uniprot.org/uniprot/O24219 O24219]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93235 P93235]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9STR4 Q9STR4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9T065 Q9T065]
| + | |
− | ** [http://www.uniprot.org/uniprot/O24609 O24609]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42893 Q42893]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q96579 Q96579]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q96580 Q96580]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93234 P93234]
| + | |
− | ** [http://www.uniprot.org/uniprot/O24432 O24432]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65017 O65017]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65018 O65018]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42668 Q42668]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49819 O49819]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81957 O81957]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65159 O65159]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41688 Q41688]
| + | |
− | ** [http://www.uniprot.org/uniprot/O24544 O24544]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39931 Q39931]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SAR0 Q9SAR0]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37821 P37821]
| + | |
− | ** [http://www.uniprot.org/uniprot/O24061 O24061]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9M2Y8 Q9M2Y8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SMH1 Q9SMH1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SEJ9 Q9SEJ9]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=1-aminocyclopropane-1-carboxylate synthase}} | + | |
− | {{#set: ec number=EC-4.4.1.14}} | + | |
− | {{#set: gene associated=Ec-04_003460}} | + | |
− | {{#set: in pathway=ETHYL-PWY|PWY-7270}} | + | |
− | {{#set: reconstruction category=orthology|annotation}} | + | |
− | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
| + | |
− | {{#set: reconstruction tool=pantograph|pathwaytools}}
| + | |