Difference between revisions of "Ec-05 001980"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == * smiles: ** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1) * inc...")
(Created page with "Category:Gene == Gene Ec-05_001980 == * left end position: ** 3509270 * transcription direction: ** POSITIVE * right end position: ** 3518850 * centisome position: ** 38.5...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] ==
+
== Gene Ec-05_001980 ==
−
* smiles:
+
* left end position:
−
** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)
+
** 3509270
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K
+
** POSITIVE
−
* common name:
+
* right end position:
−
** shikimate 3-phosphate
+
** 3518850
−
* molecular weight:
+
* centisome position:
−
** 251.109    
+
** 38.54856    
 
* Synonym(s):
 
* Synonym(s):
−
** shikimate 5-phosphate
+
** Esi_0004_0038
−
** shikimate-5-P
+
** Esi0004_0038
−
** 3-phosphoshikimate
+
−
** shikimate-3-P
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[2.5.1.19-RXN]]
+
*** Assignment: automated-name-match
−
* [[SHIKIMATE-KINASE-RXN]]
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3509270}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14506806 14506806]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=3518850}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=145989 145989]
+
{{#set: centisome position=38.54856   }}
−
* BIGG : 41343
+
{{#set: common name=Esi_0004_0038|Esi0004_0038}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03175 C03175]
+
−
{{#set: smiles=C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)}}
+
−
{{#set: inchi key=InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K}}
+
−
{{#set: common name=shikimate 3-phosphate}}
+
−
{{#set: molecular weight=251.109   }}
+
−
{{#set: common name=shikimate 5-phosphate|shikimate-5-P|3-phosphoshikimate|shikimate-3-P}}
+
−
{{#set: reversible reaction associated=2.5.1.19-RXN|SHIKIMATE-KINASE-RXN}}
+

Latest revision as of 19:03, 21 March 2018

Gene Ec-05_001980

  • left end position:
    • 3509270
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3518850
  • centisome position:
    • 38.54856
  • Synonym(s):
    • Esi_0004_0038
    • Esi0004_0038

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-05_001980&oldid=24190"