Difference between revisions of "DADP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4125 CPD-4125] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DADP DADP] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP([O-])([O-])=O)([O-]...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DADP DADP] == |
* smiles: | * smiles: | ||
| − | ** CC=C(C( | + | ** C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP([O-])([O-])=O)([O-])=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=DAEAPNUQQAICNR-RRKCRQDMSA-K |
* common name: | * common name: | ||
| − | ** | + | ** dADP |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 408.18 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 2'-deoxyadenosine-5'-diphosphate | ||
| + | ** deoxyadenosine-diphosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DADPKIN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-14214]] | ||
| + | * [[RXN0-747]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[ADPREDUCT-RXN]] | ||
| + | * [[RXN-14215]] | ||
| + | * [[RXN-14192]] | ||
== External links == | == External links == | ||
| + | * CAS : 2793-06-8 | ||
| + | * BIGG : 34254 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21125569 21125569] |
| + | * HMDB : HMDB01508 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00206 C00206] |
| − | * | + | * CHEMSPIDER: |
| − | {{#set: smiles=CC=C(C( | + | ** [http://www.chemspider.com/Chemical-Structure.19992628.html 19992628] |
| − | {{#set: inchi key=InChIKey= | + | * CHEBI: |
| − | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57667 57667] |
| − | {{#set: molecular weight= | + | * METABOLIGHTS : MTBLC57667 |
| − | {{#set: consumed by=RXN- | + | {{#set: smiles=C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP([O-])([O-])=O)([O-])=O}} |
| + | {{#set: inchi key=InChIKey=DAEAPNUQQAICNR-RRKCRQDMSA-K}} | ||
| + | {{#set: common name=dADP}} | ||
| + | {{#set: molecular weight=408.18 }} | ||
| + | {{#set: common name=2'-deoxyadenosine-5'-diphosphate|deoxyadenosine-diphosphate}} | ||
| + | {{#set: consumed by=DADPKIN-RXN}} | ||
| + | {{#set: produced by=RXN-14214|RXN0-747}} | ||
| + | {{#set: reversible reaction associated=ADPREDUCT-RXN|RXN-14215|RXN-14192}} | ||
Latest revision as of 19:03, 21 March 2018
Contents
Metabolite DADP
- smiles:
- C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP([O-])([O-])=O)([O-])=O
- inchi key:
- InChIKey=DAEAPNUQQAICNR-RRKCRQDMSA-K
- common name:
- dADP
- molecular weight:
- 408.18
- Synonym(s):
- 2'-deoxyadenosine-5'-diphosphate
- deoxyadenosine-diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 2793-06-8
- BIGG : 34254
- PUBCHEM:
- HMDB : HMDB01508
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC57667
"C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP([O-])([O-])=O)([O-])=O" cannot be used as a page name in this wiki.
