Difference between revisions of "PWY-5523"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O * inchi key: ** InChIK...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5523 PWY-5523] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5523 PWY-5523] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 5,6-dimethylbenzimidazole biosynthesis I (aerobic) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** DMB biosynthesis I |
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''3''' reactions in the full pathway |
| − | + | * [[RIBOFLAVINKIN-RXN]] | |
| − | == Reaction(s) | + | ** 4 associated gene(s): |
| + | *** [[Ec-04_001490]] | ||
| + | *** [[Ec-04_004280]] | ||
| + | *** [[Ec-10_002950]] | ||
| + | *** [[Ec-14_005260]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=FMNREDUCT-RXN FMNREDUCT-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8771 RXN-8771] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=5,6-dimethylbenzimidazole biosynthesis I (aerobic)}} | |
| − | + | {{#set: common name=DMB biosynthesis I}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=33.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:03, 21 March 2018
Pathway PWY-5523
- taxonomic range:
- common name:
- 5,6-dimethylbenzimidazole biosynthesis I (aerobic)
- Synonym(s):
- DMB biosynthesis I
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- RIBOFLAVINKIN-RXN
- 4 associated gene(s):
- 2 reconstruction source(s) associated:
