Difference between revisions of "PWY-7102"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7109 CPD-7109] == * smiles: ** CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C * inchi key: **...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7102 PWY-7102] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7102 PWY-7102] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** bisabolene biosynthesis (engineered) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''3''' reactions found over '''6''' reactions in the full pathway |
− | + | * [[FPPSYN-RXN]] | |
− | * [[RXN- | + | ** 3 associated gene(s): |
− | == Reaction(s) | + | *** [[Ec-10_003020]] |
+ | *** [[Ec-07_006170]] | ||
+ | *** [[Ec-16_004330]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[GPPSYN-RXN]] | ||
+ | ** 12 associated gene(s): | ||
+ | *** [[Ec-21_000990]] | ||
+ | *** [[Ec-14_006550]] | ||
+ | *** [[Ec-08_002270]] | ||
+ | *** [[Ec-00_007350]] | ||
+ | *** [[Ec-25_002110]] | ||
+ | *** [[Ec-10_003020]] | ||
+ | *** [[Ec-18_000990]] | ||
+ | *** [[Ec-26_003280]] | ||
+ | *** [[Ec-17_001240]] | ||
+ | *** [[Ec-16_004330]] | ||
+ | *** [[Ec-07_006170]] | ||
+ | *** [[Ec-24_003910]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[IPPISOM-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Ec-11_001030]] | ||
+ | *** [[Ec-18_002690]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8429 RXN-8429] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8549 RXN-8549] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8550 RXN-8550] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: taxonomic range=TAX-1224}} | |
− | {{#set: | + | {{#set: common name=bisabolene biosynthesis (engineered)}} |
− | {{#set: | + | {{#set: reaction found=3}} |
− | {{#set: common name= | + | {{#set: total reaction=6}} |
− | {{#set: | + | {{#set: completion rate=50.0}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:03, 21 March 2018
Pathway PWY-7102
Reaction(s) found
3 reactions found over 6 reactions in the full pathway
- FPPSYN-RXN
- 3 associated gene(s):
- 2 reconstruction source(s) associated:
- GPPSYN-RXN
- 12 associated gene(s):
- 2 reconstruction source(s) associated:
- IPPISOM-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated: