Difference between revisions of "GLC-6-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5064 PWY-5064] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O * inchi key: ** InChIK...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5064 PWY-5064] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O
 +
* inchi key:
 +
** InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L
 
* common name:
 
* common name:
−
** chlorophyll a biosynthesis II
+
** β-D-glucose 6-phosphate
 +
* molecular weight:
 +
** 258.121   
 
* Synonym(s):
 
* Synonym(s):
 +
** β-D-glucose-6-P
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''3''' reactions found over '''5''' reactions in the full pathway
+
* [[RXN66-579]]
−
* [[RXN-7664]]
+
== Reaction(s) known to produce the compound ==
−
** 1 associated gene(s):
+
== Reaction(s) of unknown directionality ==
−
*** [[Ec-03_003520]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-7665]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-03_003520]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-7666]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-03_003520]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-5286 RXN-5286]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7663 RXN-7663]
+
 
== External links  ==
 
== External links  ==
−
* ARACYC:
+
* PUBCHEM:
−
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5064 PWY-5064]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21604865 21604865]
−
{{#set: taxonomic range=TAX-33090}}
+
* HMDB : HMDB03498
−
{{#set: common name=chlorophyll a biosynthesis II}}
+
* LIGAND-CPD:
−
{{#set: reaction found=3}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01172 C01172]
−
{{#set: total reaction=5}}
+
* CHEMSPIDER:
−
{{#set: completion rate=60.0}}
+
** [http://www.chemspider.com/Chemical-Structure.10239176.html 10239176]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58247 58247]
 +
* BIGG : 36977
 +
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O}}
 +
{{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L}}
 +
{{#set: common name=β-D-glucose 6-phosphate}}
 +
{{#set: molecular weight=258.121    }}
 +
{{#set: common name=β-D-glucose-6-P}}
 +
{{#set: consumed by=RXN66-579}}

Latest revision as of 19:03, 21 March 2018

Metabolite GLC-6-P

  • smiles:
    • C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O
  • inchi key:
    • InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L
  • common name:
    • β-D-glucose 6-phosphate
  • molecular weight:
    • 258.121
  • Synonym(s):
    • β-D-glucose-6-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=GLC-6-P&oldid=24245"