Difference between revisions of "GLYCINE-SYN2-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLYCINE-SYN2-PWY GLYCINE-SYN2-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLYCINE-SYN2-PWY GLYCINE-SYN2-PWY] ==
* smiles:
+
* taxonomic range:
** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154]
* inchi key:
+
** InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N
+
 
* common name:
 
* common name:
** 14-oxolanosterol
+
** glycine biosynthesis II
* molecular weight:
+
** 440.708   
+
 
* Synonym(s):
 
* Synonym(s):
** 14-oxo-lanosterol
 
** 4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN66-305]]
+
'''2''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[GCVP-RXN]]
* [[RXN66-304]]
+
** 2 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-07_004110]]
 +
*** [[Ec-23_004150]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[GLYCLEAV-PWY]]
 +
** 0 associated gene:
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33154}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203567 25203567]
+
{{#set: common name=glycine biosynthesis II}}
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
+
{{#set: reaction found=2}}
{{#set: inchi key=InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N}}
+
{{#set: total reaction=3}}
{{#set: common name=14-oxolanosterol}}
+
{{#set: completion rate=67.0}}
{{#set: molecular weight=440.708    }}
+
{{#set: common name=14-oxo-lanosterol|4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol}}
+
{{#set: consumed by=RXN66-305}}
+
{{#set: produced by=RXN66-304}}
+

Latest revision as of 19:03, 21 March 2018

Pathway GLYCINE-SYN2-PWY

  • taxonomic range:
  • common name:
    • glycine biosynthesis II
  • Synonym(s):

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links