Difference between revisions of "CPD1F-136"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY6666-2 PWY6666-2] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-136 CPD1F-136] == * smiles: ** C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23)...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY6666-2 PWY6666-2] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-136 CPD1F-136] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
+
** C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4)))
 +
* inchi key:
 +
** InChIKey=KMLXVEXJZSTMBV-YDIYEOSVSA-M
 
* common name:
 
* common name:
** dopamine degradation
+
** ent-7α-hydroxykaur-16-en-19-oate
 +
* molecular weight:
 +
** 317.447   
 
* Synonym(s):
 
* Synonym(s):
 +
** ent-7-α-hydroxykaurenoate
 +
** ent-7-α-hydroxykaurenoic acid
 +
** 7-hydroxy-kaurenoic acid
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''2''' reactions found over '''5''' reactions in the full pathway
+
* [[RXN1F-160]]
* [[RXN6666-4]]
+
== Reaction(s) known to produce the compound ==
** 2 associated gene(s):
+
* [[1.14.13.79-RXN]]
*** [[Ec-15_002920]]
+
== Reaction(s) of unknown directionality ==
*** [[Ec-15_002910]]
+
** 1 reconstruction source(s) associated:
+
*** [[orthology-aragem]]
+
* [[RXN6666-9]]
+
** 5 associated gene(s):
+
*** [[Ec-00_005410]]
+
*** [[Ec-06_007300]]
+
*** [[Ec-06_007310]]
+
*** [[Ec-26_003630]]
+
*** [[Ec-06_007320]]
+
** 1 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN6666-5 RXN6666-5]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN6666-6 RXN6666-6]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN6666-7 RXN6666-7]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-33208}}
+
* LIPID_MAPS : LMPR0104540005
{{#set: common name=dopamine degradation}}
+
* PUBCHEM:
{{#set: reaction found=2}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200352 25200352]
{{#set: total reaction=5}}
+
* CHEBI:
{{#set: completion rate=40.0}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57298 57298]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C11875 C11875]
 +
{{#set: smiles=C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4)))}}
 +
{{#set: inchi key=InChIKey=KMLXVEXJZSTMBV-YDIYEOSVSA-M}}
 +
{{#set: common name=ent-7α-hydroxykaur-16-en-19-oate}}
 +
{{#set: molecular weight=317.447    }}
 +
{{#set: common name=ent-7-α-hydroxykaurenoate|ent-7-α-hydroxykaurenoic acid|7-hydroxy-kaurenoic acid}}
 +
{{#set: consumed by=RXN1F-160}}
 +
{{#set: produced by=1.14.13.79-RXN}}

Latest revision as of 19:04, 21 March 2018

Metabolite CPD1F-136

  • smiles:
    • C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4)))
  • inchi key:
    • InChIKey=KMLXVEXJZSTMBV-YDIYEOSVSA-M
  • common name:
    • ent-7α-hydroxykaur-16-en-19-oate
  • molecular weight:
    • 317.447
  • Synonym(s):
    • ent-7-α-hydroxykaurenoate
    • ent-7-α-hydroxykaurenoic acid
    • 7-hydroxy-kaurenoic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4)))" cannot be used as a page name in this wiki.