Difference between revisions of "FAD"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-14_005330 == * left end position: ** 4916703 * transcription direction: ** POSITIVE * right end position: ** 4919999 * centisome position: ** 74.9...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FAD FAD] == * smiles: ** CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FAD FAD] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6)) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K |
| − | * | + | * common name: |
| − | ** | + | ** FAD |
| − | * | + | * molecular weight: |
| − | ** | + | ** 782.533 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** flavin adenine dinucleotide oxidized |
| − | ** | + | ** flavin adenine dinucleotide |
| + | ** flavitan | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[MEPROPCOA-FAD-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[FADSYN-RXN]] |
| − | == | + | == Reaction(s) of unknown directionality == |
| + | * [[RXN-14264]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 146-14-5 |
| − | {{#set: | + | * Wikipedia : Flavin_adenine_dinucleotide |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46906035 46906035] |
| − | {{#set: common name= | + | * HMDB : HMDB01248 |
| − | {{#set: reaction associated= | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00016 C00016] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.13082029.html 13082029] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57692 57692] | ||
| + | * BIGG : 33521 | ||
| + | {{#set: smiles=CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))}} | ||
| + | {{#set: inchi key=InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K}} | ||
| + | {{#set: common name=FAD}} | ||
| + | {{#set: molecular weight=782.533 }} | ||
| + | {{#set: common name=flavin adenine dinucleotide oxidized|flavin adenine dinucleotide|flavitan}} | ||
| + | {{#set: consumed by=MEPROPCOA-FAD-RXN}} | ||
| + | {{#set: produced by=FADSYN-RXN}} | ||
| + | {{#set: reversible reaction associated=RXN-14264}} | ||
Latest revision as of 19:04, 21 March 2018
Contents
Metabolite FAD
- smiles:
- CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))
- inchi key:
- InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K
- common name:
- FAD
- molecular weight:
- 782.533
- Synonym(s):
- flavin adenine dinucleotide oxidized
- flavin adenine dinucleotide
- flavitan
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 146-14-5
- Wikipedia : Flavin_adenine_dinucleotide
- PUBCHEM:
- HMDB : HMDB01248
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : 33521
"CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))" cannot be used as a page name in this wiki.
