Difference between revisions of "THREDEHYD-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=8-AMINO-7-OXONONANOATE 8-AMINO-7-OXONONANOATE] == * smiles: ** CC(C(CCCCCC([O-])=O)=O)[N+] * in...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THREDEHYD-RXN THREDEHYD-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Tryptophan synthase...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=8-AMINO-7-OXONONANOATE 8-AMINO-7-OXONONANOATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=THREDEHYD-RXN THREDEHYD-RXN] ==
−
* smiles:
+
* direction:
−
** CC(C(CCCCCC([O-])=O)=O)[N+]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=GUAHPAJOXVYFON-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** 8-amino-7-oxononanoate
+
** Tryptophan synthase beta subunit-like PLP-dependent enzyme
−
* molecular weight:
+
** L-threonine ammonia-lyase
−
** 187.238   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/4.3.1.19 EC-4.3.1.19]
 
* Synonym(s):
 
* Synonym(s):
−
** 7-keto-8-aminopelargonate
 
−
** KAPA
 
−
** 7-KAP
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[7KAPSYN-RXN]]
+
** 1 [[THR]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[2-OXOBUTANOATE]][c]
−
* [[RXN-11484]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 L-threonine[c] '''=>''' 1 ammonium[c] '''+''' 1 2-oxobutanoate[c]
−
* [[DAPASYN-RXN]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-03_001910]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-06_007490]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY66-428]], L-threonine degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-428 PWY66-428]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
* RHEA:
−
** [http://www.genome.jp/dbget-bin/www_bget?C01092 C01092]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22108 22108]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57532 57532]
+
** [http://www.genome.jp/dbget-bin/www_bget?R00996 R00996]
−
* BIGG : 36792
+
* UNIPROT:
−
* PUBCHEM:
+
** [http://www.uniprot.org/uniprot/P25306 P25306]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244029 25244029]
+
** [http://www.uniprot.org/uniprot/Q04513 Q04513]
−
* HMDB : HMDB37790
+
** [http://www.uniprot.org/uniprot/P37946 P37946]
−
{{#set: smiles=CC(C(CCCCCC([O-])=O)=O)[N+]}}
+
** [http://www.uniprot.org/uniprot/Q9JZW1 Q9JZW1]
−
{{#set: inchi key=InChIKey=GUAHPAJOXVYFON-UHFFFAOYSA-N}}
+
** [http://www.uniprot.org/uniprot/Q02145 Q02145]
−
{{#set: common name=8-amino-7-oxononanoate}}
+
** [http://www.uniprot.org/uniprot/P66897 P66897]
−
{{#set: molecular weight=187.238    }}
+
** [http://www.uniprot.org/uniprot/Q9WYJ1 Q9WYJ1]
−
{{#set: common name=7-keto-8-aminopelargonate|KAPA|7-KAP}}
+
** [http://www.uniprot.org/uniprot/Q9PP95 Q9PP95]
−
{{#set: produced by=7KAPSYN-RXN|RXN-11484}}
+
** [http://www.uniprot.org/uniprot/P25379 P25379]
−
{{#set: reversible reaction associated=DAPASYN-RXN}}
+
** [http://www.uniprot.org/uniprot/P00927 P00927]
 +
** [http://www.uniprot.org/uniprot/P20506 P20506]
 +
** [http://www.uniprot.org/uniprot/P0AGF6 P0AGF6]
 +
** [http://www.uniprot.org/uniprot/P04968 P04968]
 +
** [http://www.uniprot.org/uniprot/P20132 P20132]
 +
** [http://www.uniprot.org/uniprot/P09367 P09367]
 +
** [http://www.uniprot.org/uniprot/Q9RWU8 Q9RWU8]
 +
** [http://www.uniprot.org/uniprot/Q9JUX5 Q9JUX5]
 +
** [http://www.uniprot.org/uniprot/Q9ZD93 Q9ZD93]
 +
** [http://www.uniprot.org/uniprot/P31212 P31212]
 +
** [http://www.uniprot.org/uniprot/P36007 P36007]
 +
** [http://www.uniprot.org/uniprot/P73375 P73375]
 +
** [http://www.uniprot.org/uniprot/Q9T0D1 Q9T0D1]
 +
** [http://www.uniprot.org/uniprot/Q39469 Q39469]
 +
** [http://www.uniprot.org/uniprot/Q93968 Q93968]
 +
** [http://www.uniprot.org/uniprot/Q9XAA4 Q9XAA4]
 +
** [http://www.uniprot.org/uniprot/O94634 O94634]
 +
** [http://www.uniprot.org/uniprot/O59791 O59791]
 +
{{#set: direction=LEFT-TO-RIGHT}}
 +
{{#set: common name=Tryptophan synthase beta subunit-like PLP-dependent enzyme}}
 +
{{#set: common name=L-threonine ammonia-lyase}}
 +
{{#set: ec number=EC-4.3.1.19}}
 +
{{#set: gene associated=Ec-03_001910|Ec-06_007490}}
 +
{{#set: in pathway=PWY66-428}}
 +
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 19:04, 21 March 2018

Reaction THREDEHYD-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Tryptophan synthase beta subunit-like PLP-dependent enzyme
    • L-threonine ammonia-lyase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 L-threonine[c] => 1 ammonium[c] + 1 2-oxobutanoate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-428, L-threonine degradation V: PWY66-428
    • 2 reactions found over 2 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=THREDEHYD-RXN&oldid=24319"