Difference between revisions of "RXN-5469"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRPP PRPP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(OP([O-])(=O)OP([O-])(=O)[O-])C(O)C(O)1) * i...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5469 RXN-5469] == * direction: ** LEFT-TO-RIGHT * common name: ** Dolichyl-P-Man:Man(5)GlcNAc(2...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5469 RXN-5469] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** Dolichyl-P-Man:Man(5)GlcNAc(2)-PP-dolichyl mannosyltransferase, family GT58 |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.4.1.261 EC-2.4.1.261] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[CPD-171]][c] '''+''' 1 [[CPD-5167]][c] '''=>''' 1 [[CPD-5168]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[DOLICHOLP]][c] | |
− | + | * With common name(s): | |
− | + | ** 1 a dolichyl β-D-mannosyl phosphate[c] '''+''' 1 a (mannosyl)8-(N-acetylglucosaminyl)2-diphosphodolichol[c] '''=>''' 1 a (mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol[c] '''+''' 1 H+[c] '''+''' 1 a dolichyl phosphate[c] | |
− | + | ||
− | = | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[Ec-12_007710]] |
− | * | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: EC-NUMBER |
− | + | == Pathways == | |
− | * [[ | + | * [[MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]], protein N-glycosylation (eukaryotic, high mannose): [http://metacyc.org/META/NEW-IMAGE?object=MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS] |
− | * [[ | + | ** '''19''' reactions found over '''19''' reactions in the full pathway |
− | * [[ | + | == Reconstruction information == |
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=29542 29542] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R06261 R06261] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | * LIGAND- | + | {{#set: common name=Dolichyl-P-Man:Man(5)GlcNAc(2)-PP-dolichyl mannosyltransferase, family GT58}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-2.4.1.261}} |
− | + | {{#set: gene associated=Ec-12_007710}} | |
− | + | {{#set: in pathway=MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:04, 21 March 2018
Contents
Reaction RXN-5469
- direction:
- LEFT-TO-RIGHT
- common name:
- Dolichyl-P-Man:Man(5)GlcNAc(2)-PP-dolichyl mannosyltransferase, family GT58
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 a dolichyl β-D-mannosyl phosphate[c] + 1 a (mannosyl)8-(N-acetylglucosaminyl)2-diphosphodolichol[c] => 1 a (mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol[c] + 1 H+[c] + 1 a dolichyl phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-12_007710
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
- MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS, protein N-glycosylation (eukaryotic, high mannose): MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS
- 19 reactions found over 19 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links