Difference between revisions of "Ec-14 004740"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PREPHENATE PREPHENATE] == * smiles: ** C(=O)([O-])C(=O)CC1(C(=O)[O-])(C=CC(O)C=C1) * inchi key:...") |
(Created page with "Category:Gene == Gene Ec-14_004740 == * left end position: ** 4411514 * transcription direction: ** POSITIVE * right end position: ** 4428411 * centisome position: ** 67.2...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-14_004740 == |
− | * | + | * left end position: |
− | ** | + | ** 4411514 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4428411 |
− | * | + | * centisome position: |
− | ** | + | ** 67.2443 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0189_0035 | ||
+ | ** Esi0189_0035 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[4.2.2.10-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Assignment: automated-name-match | |
− | * [[ | + | * Reaction: [[RXN-14897]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | * | + | == Pathways associated == |
− | * [[ | + | * [[PWY-7243]] |
== External links == | == External links == | ||
− | + | {{#set: left end position=4411514}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4428411}} | |
− | + | {{#set: centisome position=67.2443 }} | |
− | + | {{#set: common name=Esi_0189_0035|Esi0189_0035}} | |
− | + | {{#set: reaction associated=4.2.2.10-RXN|RXN-14897}} | |
− | + | {{#set: pathway associated=PWY-7243}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:05, 21 March 2018
Gene Ec-14_004740
- left end position:
- 4411514
- transcription direction:
- POSITIVE
- right end position:
- 4428411
- centisome position:
- 67.2443
- Synonym(s):
- Esi_0189_0035
- Esi0189_0035
Reactions associated
- Reaction: 4.2.2.10-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-14897
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome