Difference between revisions of "PWY-5941"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CANALINE L-CANALINE] == * smiles: ** C(CC([N+])C(=O)[O-])ON * inchi key: ** InChIKey=FQPGMQAB...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5941 PWY-5941] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CANALINE L-CANALINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5941 PWY-5941] ==
* smiles:
+
* taxonomic range:
** C(CC([N+])C(=O)[O-])ON
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=FQPGMQABJNQLLF-VKHMYHEASA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154]
 
* common name:
 
* common name:
** L-canaline
+
** glycogen degradation II
* molecular weight:
+
** 134.135   
+
 
* Synonym(s):
 
* Synonym(s):
** L-a-amino-g-(aminooxy)-n-butyric acid
+
** glycogenolysis II
** L-2-amino-4-(aminooxy)butyric acid
+
** L-2-amino-4-(aminooxy)butyrate
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-9]]
+
'''1''' reactions found over '''6''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[PHOSPHOGLUCMUT-RXN]]
* [[RXN-34]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-17_001480]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.33-RXN 3.2.1.33-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=GLYCOPHOSPHORYL-RXN GLYCOPHOSPHORYL-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9023 RXN-9023]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9024 RXN-9024]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9025 RXN-9025]
 
== External links  ==
 
== External links  ==
* CAS : 496-93-5
+
{{#set: taxonomic range=TAX-2157}}
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246035 25246035]
+
{{#set: taxonomic range=TAX-33154}}
* LIGAND-CPD:
+
{{#set: common name=glycogen degradation II}}
** [http://www.genome.jp/dbget-bin/www_bget?C08270 C08270]
+
{{#set: common name=glycogenolysis II}}
* HMDB : HMDB12251
+
{{#set: reaction found=1}}
{{#set: smiles=C(CC([N+])C(=O)[O-])ON}}
+
{{#set: total reaction=6}}
{{#set: inchi key=InChIKey=FQPGMQABJNQLLF-VKHMYHEASA-N}}
+
{{#set: completion rate=17.0}}
{{#set: common name=L-canaline}}
+
{{#set: molecular weight=134.135    }}
+
{{#set: common name=L-a-amino-g-(aminooxy)-n-butyric acid|L-2-amino-4-(aminooxy)butyric acid|L-2-amino-4-(aminooxy)butyrate}}
+
{{#set: consumed by=RXN-9}}
+
{{#set: produced by=RXN-34}}
+

Latest revision as of 20:05, 21 March 2018

Pathway PWY-5941

Reaction(s) found

1 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links