Difference between revisions of "CPD-8607"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6883 RXN-6883] == * direction: ** LEFT-TO-RIGHT * common name: ** Alternative oxidase * ec numb...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C |
| + | * inchi key: | ||
| + | ** InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol |
| − | * | + | * molecular weight: |
| − | ** | + | ** 444.74 |
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN66-12]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN66-11]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201302 25201302] |
| − | * | + | * HMDB : HMDB12160 |
| − | + | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}} | |
| − | {{#set: | + | {{#set: inchi key=InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N}} |
| − | + | {{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol}} | |
| − | {{#set: | + | {{#set: molecular weight=444.74 }} |
| − | {{#set: | + | {{#set: consumed by=RXN66-12}} |
| − | + | {{#set: produced by=RXN66-11}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:05, 21 March 2018
Contents
Metabolite CPD-8607
- smiles:
- CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
- inchi key:
- InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N
- common name:
- 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol
- molecular weight:
- 444.74
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB12160
"CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.
